N-[1-[(3,5-dimethylisoxazol-4-yl)methyl]pyrazol-4-yl]-4-hydroxy-benzamide

ID: ALA4567380

PubChem CID: 155544814

Max Phase: Preclinical

Molecular Formula: C16H16N4O3

Molecular Weight: 312.33

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1noc(C)c1Cn1cc(NC(=O)c2ccc(O)cc2)cn1

Standard InChI:  InChI=1S/C16H16N4O3/c1-10-15(11(2)23-19-10)9-20-8-13(7-17-20)18-16(22)12-3-5-14(21)6-4-12/h3-8,21H,9H2,1-2H3,(H,18,22)

Standard InChI Key:  PWXUDGREWRETTH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
    2.9386  -25.4361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7557  -25.4361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0101  -24.6594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3471  -24.1773    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6884  -24.6594    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4574  -26.0966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7877  -24.4080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2353  -26.0978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0481  -26.0133    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5933  -26.6212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3403  -26.2897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2558  -25.4769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4567  -25.3061    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0475  -26.6991    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7557  -26.2914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4629  -26.7008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7566  -25.4742    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4571  -27.5173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1635  -27.9266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8727  -27.5188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8710  -26.6974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1640  -26.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5805  -27.9273    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  1  1  0
  1  6  1  0
  3  7  1  0
  2  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  9  1  0
 11 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 16 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 16  1  0
 20 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4567380

    ---

Associated Targets(Human)

TAS2R8 Tchem Taste receptor type 2 member 8 (387 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 312.33Molecular Weight (Monoisotopic): 312.1222AlogP: 2.49#Rotatable Bonds: 4
Polar Surface Area: 93.18Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.60CX Basic pKa: 1.71CX LogP: 1.61CX LogD: 1.58
Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.77Np Likeness Score: -2.18

References

1. Fotsing JR, Darmohusodo V, Patron AP, Ching BW, Brady T, Arellano M, Chen Q, Davis TJ, Liu H, Servant G, Zhang L, Williams M, Saganich M, Ditschun T, Tachdjian C, Karanewsky DS..  (2020)  Discovery and Development of S6821 and S7958 as Potent TAS2R8 Antagonists.,  63  (9): [PMID:32330040] [10.1021/acs.jmedchem.0c00388]

Source