The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N1-((3-chloropyridin-2-yl)(2,2-difluorobenzo[d][1,3]dioxol-4-yl)methyl)-N2-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-(methylsulfonyl)benzene-1,2-diamine ID: ALA4567485
PubChem CID: 145712402
Max Phase: Preclinical
Molecular Formula: C25H21ClF2N6O6S
Molecular Weight: 607.00
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1nc(Nc2cc(S(C)(=O)=O)ccc2N[C@@H](c2cccc3c2OC(F)(F)O3)c2ncccc2Cl)nc(OC)n1
Standard InChI: InChI=1S/C25H21ClF2N6O6S/c1-37-23-32-22(33-24(34-23)38-2)31-17-12-13(41(3,35)36)9-10-16(17)30-19(20-15(26)7-5-11-29-20)14-6-4-8-18-21(14)40-25(27,28)39-18/h4-12,19,30H,1-3H3,(H,31,32,33,34)/t19-/m0/s1
Standard InChI Key: ZKUCSIBYPOHTCH-IBGZPJMESA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
8.3081 -25.7952 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.5982 -26.2079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3127 -26.6169 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.5140 -20.8838 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3353 -20.8879 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.9261 -20.1740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3360 -24.1733 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6242 -24.5821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9123 -24.1736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9157 -23.3517 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2046 -22.9393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4919 -23.3522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4947 -24.1777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2064 -24.5824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6245 -25.4029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9111 -25.8151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9110 -26.6357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6234 -27.0450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2096 -25.4037 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6.3358 -23.3520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0499 -22.9414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0501 -22.1209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3376 -21.7116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6235 -22.1248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6269 -22.9440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0475 -20.4765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7610 -23.3555 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4695 -22.9442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1791 -23.3611 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8912 -22.9504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8932 -22.1282 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1772 -21.7184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4680 -22.1273 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1759 -20.8971 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8871 -20.4832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3342 -25.8126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3407 -26.6338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1240 -26.8801 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1134 -25.5498 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5983 -23.3600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5971 -24.1772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 2 0
6 5 2 0
8 7 1 1
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 37 1 0
36 15 1 0
8 15 1 0
14 19 1 0
7 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
23 5 1 0
5 26 1 0
21 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
32 34 1 0
34 35 1 0
36 37 2 0
37 38 1 0
38 2 1 0
2 39 1 0
39 36 1 0
30 40 1 0
40 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 607.00Molecular Weight (Monoisotopic): 606.0900AlogP: 4.61#Rotatable Bonds: 9Polar Surface Area: 146.68Molecular Species: NEUTRALHBA: 12HBD: 2#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.06CX Basic pKa: 1.38CX LogP: 5.47CX LogD: 5.47Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.27Np Likeness Score: -1.23
References 1. Stauffer F, Weiss A, Scheufler C, Möbitz H, Ragot C, Beyer KS, Calkins K, Guthy D, Kiffe M, Van Eerdenbrugh B, Tiedt R, Gaul C.. (2019) New Potent DOT1L Inhibitors for in Vivo Evaluation in Mouse., 10 (12): [PMID:31857842 ] [10.1021/acsmedchemlett.9b00452 ]