The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[2-(6-Isopropyl-7,8-dihydro-6H-9-oxa-1,2,3a,4,6-pentaazacyclopenta[a]naphthalen-3-yl)-quinolin-8-yl]-piperidin-4-ylmethyl-amine ID: ALA4567516
PubChem CID: 155558576
Max Phase: Preclinical
Molecular Formula: C25H30N8O
Molecular Weight: 458.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)N1CCOc2c1cnn1c(-c3ccc4cccc(NCC5CCNCC5)c4n3)nnc21
Standard InChI: InChI=1S/C25H30N8O/c1-16(2)32-12-13-34-23-21(32)15-28-33-24(30-31-25(23)33)20-7-6-18-4-3-5-19(22(18)29-20)27-14-17-8-10-26-11-9-17/h3-7,15-17,26-27H,8-14H2,1-2H3
Standard InChI Key: ZFJYBIDCQXNLFR-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 39 0 0 0 0 0 0 0 0999 V2000
5.6476 -4.1295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3557 -4.5385 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0625 -3.3064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0628 -4.1250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8414 -4.3778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3224 -3.7153 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8410 -3.0532 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6488 -3.3100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3553 -2.9029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3560 -2.0920 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6519 -1.6820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9453 -2.0891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9430 -2.9062 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0941 -5.1549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5443 -5.7609 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1441 -6.0953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8890 -5.3212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5966 -6.7077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7986 -6.5351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2522 -7.1392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5025 -7.9160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3044 -8.0854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8473 -7.4800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4533 -6.9674 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9050 -7.5734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1061 -7.4016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8582 -6.6236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0632 -6.4507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5116 -7.0541 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7607 -7.8334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5614 -8.0092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2355 -3.3151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5275 -2.9069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2359 -4.1323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8 1 1 0
1 2 2 0
2 4 1 0
3 9 1 0
3 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 3 2 0
8 9 2 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
5 14 1 0
14 15 2 0
15 19 1 0
18 16 1 0
16 17 2 0
17 14 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 18 2 0
20 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
26 31 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
13 32 1 0
32 33 1 0
32 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 458.57Molecular Weight (Monoisotopic): 458.2543AlogP: 3.36#Rotatable Bonds: 5Polar Surface Area: 92.50Molecular Species: BASEHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 10.35CX LogP: 2.39CX LogD: -0.38Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.47Np Likeness Score: -1.26
References 1. Martínez-González S, Rodríguez-Arístegui S, Gómez de la Oliva CA, Hernández AI, González Cantalapiedra E, Varela C, García AB, Rabal O, Oyarzabal J, Bischoff JR, Klett J, Albarrán MI, Cebriá A, Ajenjo N, García-Serelde B, Gómez-Casero E, Cuadrado-Urbano M, Cebrián D, Blanco-Aparicio C, Pastor J.. (2019) Discovery of novel triazolo[4,3-b]pyridazin-3-yl-quinoline derivatives as PIM inhibitors., 168 [PMID:30802730 ] [10.1016/j.ejmech.2019.02.022 ]