The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-(4-Amino-5-(5,7-dimethoxybenzo[b]thiophen-2-yl)-7H-pyrrolo[2,3-d]pyrimidin-7-yl)pyrrolidin-1-yl)prop-2-en-1-one ID: ALA4567572
PubChem CID: 132245921
Max Phase: Preclinical
Molecular Formula: C23H23N5O3S
Molecular Weight: 449.54
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)N1CCC(n2cc(-c3cc4cc(OC)cc(OC)c4s3)c3c(N)ncnc32)C1
Standard InChI: InChI=1S/C23H23N5O3S/c1-4-19(29)27-6-5-14(10-27)28-11-16(20-22(24)25-12-26-23(20)28)18-8-13-7-15(30-2)9-17(31-3)21(13)32-18/h4,7-9,11-12,14H,1,5-6,10H2,2-3H3,(H2,24,25,26)
Standard InChI Key: XJYAEHFIXFRYPU-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
38.2250 -5.6006 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.2238 -6.4243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9360 -6.8332 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.9342 -5.1876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6470 -5.5970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6518 -6.4198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4359 -6.6682 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.9174 -5.9989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4282 -5.3354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6930 -7.4480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9318 -4.3663 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.6761 -4.5526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2204 -8.1153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7046 -8.7736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4845 -8.5166 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.4796 -7.6953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1927 -8.9272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1927 -9.7485 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.9045 -8.5145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6163 -8.9272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4534 -4.2960 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
40.1894 -3.8907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6658 -3.2268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4468 -3.4757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0529 -2.9236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8792 -2.1226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0940 -1.8766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4912 -2.4302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8356 -3.1762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.9166 -1.0747 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.5188 -0.5182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4441 -2.6220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
7 10 1 0
4 11 1 0
9 12 1 0
10 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 10 1 0
15 17 1 0
17 18 2 0
17 19 1 0
19 20 2 0
12 21 1 0
21 24 1 0
23 22 1 0
22 12 2 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
25 29 1 0
27 30 1 0
30 31 1 0
29 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 449.54Molecular Weight (Monoisotopic): 449.1522AlogP: 3.87#Rotatable Bonds: 5Polar Surface Area: 95.50Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.48CX LogP: 2.66CX LogD: 2.61Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.46Np Likeness Score: -0.49
References 1. Wang Y, Li L, Fan J, Dai Y, Jiang A, Geng M, Ai J, Duan W.. (2018) Discovery of Potent Irreversible Pan-Fibroblast Growth Factor Receptor (FGFR) Inhibitors., 61 (20): [PMID:29522671 ] [10.1021/acs.jmedchem.7b01843 ]