The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4,4'-bis((2-(3,5-difluorophenyl)hydrazono)methyl)biphenyl ID: ALA4567603
PubChem CID: 146304260
Max Phase: Preclinical
Molecular Formula: C26H18F4N4
Molecular Weight: 462.45
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Fc1cc(F)cc(N/N=C/c2ccc(-c3ccc(/C=N/Nc4cc(F)cc(F)c4)cc3)cc2)c1
Standard InChI: InChI=1S/C26H18F4N4/c27-21-9-22(28)12-25(11-21)33-31-15-17-1-5-19(6-2-17)20-7-3-18(4-8-20)16-32-34-26-13-23(29)10-24(30)14-26/h1-16,33-34H/b31-15+,32-16+
Standard InChI Key: AWTWTSJDXDLSGP-IHXWQEJPSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
7.4565 -12.5137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4553 -13.3333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1634 -13.7422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8730 -13.3328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8702 -12.5101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1616 -12.1049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5733 -12.1002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2829 -12.5078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9886 -12.0972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9859 -11.2791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2717 -10.8734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5690 -11.2863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7473 -13.7413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0399 -13.3321 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3319 -13.7402 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6245 -13.3310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6299 -12.5128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9234 -12.1038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2144 -12.5118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2163 -13.3333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9235 -13.7386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6915 -10.8670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6874 -10.0498 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3930 -9.6376 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3888 -8.8204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0958 -8.4093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0920 -7.5929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3816 -7.1871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6737 -7.6037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6810 -8.4188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5097 -13.7438 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.7978 -7.1811 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.9244 -11.2866 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.9625 -7.2012 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
5 7 1 0
2 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
10 22 1 0
22 23 2 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
20 31 1 0
27 32 1 0
18 33 1 0
29 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 462.45Molecular Weight (Monoisotopic): 462.1468AlogP: 6.80#Rotatable Bonds: 7Polar Surface Area: 48.78Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 4.80CX LogP: 7.85CX LogD: 7.84Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.18Np Likeness Score: -0.82
References 1. Thamban Chandrika N, Dennis EK, Shrestha SK, Ngo HX, Green KD, Kwiatkowski S, Deaciuc AG, Dwoskin LP, Watt DS, Garneau-Tsodikova S.. (2019) N,N'-diaryl-bishydrazones in a biphenyl platform: Broad spectrum antifungal agents., 164 [PMID:30597328 ] [10.1016/j.ejmech.2018.12.042 ]