The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-Fluorophenyl)[4-methyl-1-(quinolin-2-yl)-1,4,6,7-tetrahydro-5H-[1,2,3]triazolo[4,5-c]pyridin-5-yl]methanone ID: ALA4567857
PubChem CID: 145864512
Max Phase: Preclinical
Molecular Formula: C22H18FN5O
Molecular Weight: 387.42
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC1c2nnn(-c3ccc4ccccc4n3)c2CCN1C(=O)c1ccc(F)cc1
Standard InChI: InChI=1S/C22H18FN5O/c1-14-21-19(12-13-27(14)22(29)16-6-9-17(23)10-7-16)28(26-25-21)20-11-8-15-4-2-3-5-18(15)24-20/h2-11,14H,12-13H2,1H3
Standard InChI Key: LRDCYOQEJAADOU-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 33 0 0 0 0 0 0 0 0999 V2000
15.9724 -3.1903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3829 -4.0075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3829 -3.1903 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6777 -2.7776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0918 -2.7838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7983 -3.1945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0942 -1.9666 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7944 -4.0127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5000 -4.4233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2099 -4.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2097 -3.1953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5034 -2.7884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9170 -4.4265 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.0900 -4.4172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6777 -4.4120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9724 -4.0075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3698 -4.5532 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7026 -5.2951 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5108 -5.2077 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.5700 -4.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3191 -3.6093 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2326 -4.8303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0310 -4.9945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9741 -4.0507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5207 -3.4436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2679 -2.6688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4689 -2.4998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9232 -3.1119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1789 -3.8843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 16 1 0
1 4 1 0
15 2 1 0
2 3 1 0
3 4 1 0
3 5 1 0
5 6 1 0
5 7 2 0
6 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 6 1 0
10 13 1 0
2 14 1 0
15 16 2 0
16 17 1 0
17 18 1 0
18 19 2 0
19 15 1 0
17 20 1 0
20 21 2 0
21 25 1 0
24 22 1 0
22 23 2 0
23 20 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 24 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 387.42Molecular Weight (Monoisotopic): 387.1495AlogP: 3.71#Rotatable Bonds: 2Polar Surface Area: 63.91Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 0.02CX LogP: 3.98CX LogD: 3.98Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.53Np Likeness Score: -1.67
References 1. Yamamoto K, Inuki S, Ohno H, Oishi S.. (2019) Scaffold hopping of fused piperidine-type NK3 receptor antagonists to reduce environmental impact., 27 (10): [PMID:30975505 ] [10.1016/j.bmc.2019.03.059 ]