7-{(3-ethoxy-4-methoxyphenyl)[(4-methyl-2-pyridinyl)amino]methyl}-2-methyl-8-quinolinol

ID: ALA4567881

PubChem CID: 2943886

Max Phase: Preclinical

Molecular Formula: C26H27N3O3

Molecular Weight: 429.52

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOc1cc(C(Nc2cc(C)ccn2)c2ccc3ccc(C)nc3c2O)ccc1OC

Standard InChI:  InChI=1S/C26H27N3O3/c1-5-32-22-15-19(9-11-21(22)31-4)24(29-23-14-16(2)12-13-27-23)20-10-8-18-7-6-17(3)28-25(18)26(20)30/h6-15,24,30H,5H2,1-4H3,(H,27,29)

Standard InChI Key:  DFGDEHMIIPYKSL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    8.1967   -4.7092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9044   -4.3006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6121   -4.7092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9044   -3.4834    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6096   -5.5274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3164   -5.9359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3150   -4.3011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0225   -4.7059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0213   -5.5245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7285   -5.9331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4375   -5.5242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4347   -4.7024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7269   -4.2975    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4894   -4.2977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7822   -4.7056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7818   -5.5236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4944   -5.9321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1987   -5.5218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0747   -4.2966    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0751   -3.4794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3676   -3.0705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0746   -5.9332    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3663   -5.5255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3125   -3.4839    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1409   -4.2912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1967   -3.0748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1994   -2.2565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4926   -1.8480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7839   -2.2567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7865   -3.0781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4939   -3.4829    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4929   -1.0308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  3  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  3  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  1 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18  1  1  0
 15 19  1  0
 19 20  1  0
 20 21  1  0
 16 22  1  0
 22 23  1  0
  7 24  1  0
 12 25  1  0
  4 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 28 32  1  0
M  END

Associated Targets(Human)

RAD52 Tchem DNA repair protein RAD52 homolog (856 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 429.52Molecular Weight (Monoisotopic): 429.2052AlogP: 5.56#Rotatable Bonds: 7
Polar Surface Area: 76.50Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.57CX Basic pKa: 7.28CX LogP: 4.68CX LogD: 4.59
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.40Np Likeness Score: -1.00

References

1.  (2018)  HTS Assay for Identifying Small Molecule Inhibitors of RAD52 and Uses of Identified Small Molecule Inhibitors for Treatment and Prevention of BRCA-Deficient Malignancies, 

Source