The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-{(3-ethoxy-4-methoxyphenyl)[(4-methyl-2-pyridinyl)amino]methyl}-2-methyl-8-quinolinol ID: ALA4567881
PubChem CID: 2943886
Max Phase: Preclinical
Molecular Formula: C26H27N3O3
Molecular Weight: 429.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOc1cc(C(Nc2cc(C)ccn2)c2ccc3ccc(C)nc3c2O)ccc1OC
Standard InChI: InChI=1S/C26H27N3O3/c1-5-32-22-15-19(9-11-21(22)31-4)24(29-23-14-16(2)12-13-27-23)20-10-8-18-7-6-17(3)28-25(18)26(20)30/h6-15,24,30H,5H2,1-4H3,(H,27,29)
Standard InChI Key: DFGDEHMIIPYKSL-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
8.1967 -4.7092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9044 -4.3006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6121 -4.7092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9044 -3.4834 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6096 -5.5274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3164 -5.9359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3150 -4.3011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0225 -4.7059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0213 -5.5245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7285 -5.9331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4375 -5.5242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4347 -4.7024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7269 -4.2975 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4894 -4.2977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7822 -4.7056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7818 -5.5236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4944 -5.9321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1987 -5.5218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0747 -4.2966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0751 -3.4794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3676 -3.0705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0746 -5.9332 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3663 -5.5255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3125 -3.4839 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1409 -4.2912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1967 -3.0748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1994 -2.2565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4926 -1.8480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7839 -2.2567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7865 -3.0781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4939 -3.4829 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4929 -1.0308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
3 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 3 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
1 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 1 1 0
15 19 1 0
19 20 1 0
20 21 1 0
16 22 1 0
22 23 1 0
7 24 1 0
12 25 1 0
4 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
28 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 429.52Molecular Weight (Monoisotopic): 429.2052AlogP: 5.56#Rotatable Bonds: 7Polar Surface Area: 76.50Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.57CX Basic pKa: 7.28CX LogP: 4.68CX LogD: 4.59Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.40Np Likeness Score: -1.00
References 1. (2018) HTS Assay for Identifying Small Molecule Inhibitors of RAD52 and Uses of Identified Small Molecule Inhibitors for Treatment and Prevention of BRCA-Deficient Malignancies,