The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-((5-Hydroxy-8-methoxy-2,2-dimethyl-7-(3-methylbut-2-en-1-yl)-6-oxo-2H,6H-pyrano[3,2-b]xanthen-9-yl)oxy)pentanoic Acid ID: ALA4567905
PubChem CID: 149744413
Max Phase: Preclinical
Molecular Formula: C29H32O8
Molecular Weight: 508.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1c(OCCCCC(=O)O)cc2oc3cc4c(c(O)c3c(=O)c2c1CC=C(C)C)C=CC(C)(C)O4
Standard InChI: InChI=1S/C29H32O8/c1-16(2)9-10-18-24-20(15-22(28(18)34-5)35-13-7-6-8-23(30)31)36-21-14-19-17(11-12-29(3,4)37-19)26(32)25(21)27(24)33/h9,11-12,14-15,32H,6-8,10,13H2,1-5H3,(H,30,31)
Standard InChI Key: BBWQCGSWHGDZQR-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
47.1499 -29.2673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.8644 -29.6798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
48.5789 -29.2673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
49.2934 -29.6798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
50.0078 -29.2673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.4355 -29.6798 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
47.1499 -28.4423 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
50.7223 -29.6798 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
53.5802 -28.0298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
54.2947 -28.4423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
55.0091 -28.0298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
55.7236 -28.4423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
55.7236 -29.2673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
55.0091 -29.6798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
54.2947 -29.2673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
53.5802 -29.6798 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
52.8657 -29.2673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
52.1512 -29.6798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
51.4368 -29.2673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
51.4368 -28.4423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
52.1512 -28.0298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
52.8657 -28.4423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
56.4381 -28.0298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
57.1525 -28.4423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
57.1525 -29.2673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
56.4381 -29.6798 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
53.5802 -27.2048 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
52.1512 -27.2048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
51.4368 -26.7923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
51.4368 -25.9673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
52.1512 -25.5548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
50.7223 -25.5548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
57.4347 -30.0425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
57.9650 -29.1240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
50.7223 -28.0298 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
50.0078 -28.4423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
55.0091 -27.2048 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
1 6 2 0
1 7 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
10 15 2 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
17 22 2 0
9 22 1 0
23 24 2 0
24 25 1 0
25 26 1 0
12 23 1 0
13 26 1 0
9 27 2 0
28 29 1 0
29 30 2 0
30 31 1 0
30 32 1 0
21 28 1 0
25 33 1 0
25 34 1 0
35 36 1 0
20 35 1 0
11 37 1 0
8 19 1 0
5 8 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 508.57Molecular Weight (Monoisotopic): 508.2097AlogP: 5.99#Rotatable Bonds: 9Polar Surface Area: 115.43Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.21CX Basic pKa: ┄CX LogP: 6.07CX LogD: 2.57Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.21Np Likeness Score: 2.21
References 1. Liang J, Huang YY, Zhou Q, Gao Y, Li Z, Wu D, Yu S, Guo L, Chen Z, Huang L, Liang SH, He X, Wu R, Luo HB.. (2020) Discovery and Optimization of α-Mangostin Derivatives as Novel PDE4 Inhibitors for the Treatment of Vascular Dementia., 63 (6): [PMID:32115956 ] [10.1021/acs.jmedchem.0c00060 ]