2-Imino-1,10-dimethyl-N-(3-morpholinopropyl)-5-oxo-1,5-dihydro-2H-dipyrido[1,2-a:2',3'-d]pyrimidine-3-carboxamide

ID: ALA4567999

PubChem CID: 155560518

Max Phase: Preclinical

Molecular Formula: C21H26N6O3

Molecular Weight: 410.48

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cccn2c(=O)c3cc(C(=O)NCCCN4CCOCC4)c(=N)n(C)c3nc12

Standard InChI:  InChI=1S/C21H26N6O3/c1-14-5-3-8-27-18(14)24-19-16(21(27)29)13-15(17(22)25(19)2)20(28)23-6-4-7-26-9-11-30-12-10-26/h3,5,8,13,22H,4,6-7,9-12H2,1-2H3,(H,23,28)

Standard InChI Key:  JVMVAETWJBFUEL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   27.8588  -24.1691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8588  -24.9862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5641  -25.3907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5641  -23.7563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2694  -24.1691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2704  -24.9862    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.9665  -25.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9644  -23.7573    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.6815  -24.1672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6818  -24.9864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3874  -25.3935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0973  -24.9859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0970  -24.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3868  -23.7552    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.5641  -22.9391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9657  -26.2089    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.8050  -23.7586    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.8046  -25.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8037  -26.2124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.5127  -24.9874    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.2200  -25.3967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9281  -24.9888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6354  -25.3981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3435  -24.9903    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.0489  -25.4049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7549  -25.0005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7600  -24.1830    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.0529  -23.7715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3407  -24.1775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3854  -22.9380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  5  8  2  0
  6  7  1  0
  7 10  1  0
  9  8  1  0
  9 10  2  0
  9 14  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
  4 15  1  0
  7 16  2  0
 13 17  2  0
 12 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 24 29  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 14 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4567999

    ---

Associated Targets(Human)

A498 (42825 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
OS-RC-2 (487 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 410.48Molecular Weight (Monoisotopic): 410.2066AlogP: 0.43#Rotatable Bonds: 5
Polar Surface Area: 104.72Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.82CX LogP: -0.31CX LogD: -0.97
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.47Np Likeness Score: -1.72

References

1. Dong Z, Wang Z, Guo ZQ, Gong S, Zhang T, Liu J, Luo C, Jiang H, Yang CG..  (2020)  Structure-Activity Relationship of SPOP Inhibitors against Kidney Cancer.,  63  (9): [PMID:32297747] [10.1021/acs.jmedchem.0c00161]

Source