The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-6-Methyl-N-(4-(3-(3,4,5-trimethoxyphenyl)acryloyl)phenyl)thieno[2,3-b]quinoline-2-carboxamide ID: ALA4568408
PubChem CID: 155560610
Max Phase: Preclinical
Molecular Formula: C31H26N2O5S
Molecular Weight: 538.63
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=C/C(=O)c2ccc(NC(=O)c3cc4cc5cc(C)ccc5nc4s3)cc2)cc(OC)c1OC
Standard InChI: InChI=1S/C31H26N2O5S/c1-18-5-11-24-21(13-18)16-22-17-28(39-31(22)33-24)30(35)32-23-9-7-20(8-10-23)25(34)12-6-19-14-26(36-2)29(38-4)27(15-19)37-3/h5-17H,1-4H3,(H,32,35)/b12-6+
Standard InChI Key: UWIYEYRJJQXAOU-WUXMJOGZSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
16.5900 -3.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5889 -4.5670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2969 -4.9760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2952 -3.3386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0038 -3.7439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0045 -4.5629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7131 -4.9700 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.7075 -3.3337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4166 -3.7370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4242 -4.5561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2056 -4.8020 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.6809 -4.1348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1932 -3.4767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4981 -4.1272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9133 -4.8310 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.9000 -3.4157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.7304 -4.8234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1409 -5.5281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9573 -5.5208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3600 -4.8087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9404 -4.1026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1254 -4.1133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1772 -4.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5933 -5.5033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5782 -4.0880 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.4104 -5.4946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8266 -6.1979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4244 -6.9072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8399 -7.6100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6579 -7.6017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0587 -6.8847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6409 -6.1848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4385 -8.3218 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.0750 -8.3044 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8758 -6.8731 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.6214 -8.3302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8921 -8.2946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2944 -7.5749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8822 -3.3391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 10 2 0
9 8 2 0
8 5 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
13 9 1 0
12 14 1 0
14 15 1 0
14 16 2 0
15 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
20 23 1 0
23 24 1 0
23 25 2 0
24 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
29 33 1 0
30 34 1 0
31 35 1 0
33 36 1 0
34 37 1 0
35 38 1 0
1 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 538.63Molecular Weight (Monoisotopic): 538.1562AlogP: 6.93#Rotatable Bonds: 8Polar Surface Area: 86.75Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.69CX Basic pKa: 3.90CX LogP: 6.56CX LogD: 6.56Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.17Np Likeness Score: -0.94
References 1. Abdelbaset MS, Abdel-Aziz M, Ramadan M, Abdelrahman MH, Abbas Bukhari SN, Ali TFS, Abuo-Rahma GEA.. (2019) Discovery of novel thienoquinoline-2-carboxamide chalcone derivatives as antiproliferative EGFR tyrosine kinase inhibitors., 27 (6): [PMID:30744932 ] [10.1016/j.bmc.2019.02.012 ]