The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-4-((diethylamino)methyl)-N-(2-methoxyphenethyl)-N-(pyrrolidin-3-yl)benzamide dihydrochloride ID: ALA4568514
Cas Number: 2248666-66-0
PubChem CID: 90488837
Product Number: P288702, Order Now?
Max Phase: Preclinical
Molecular Formula: C25H37Cl2N3O2
Molecular Weight: 409.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)Cc1ccc(C(=O)N(CCc2ccccc2OC)[C@@H]2CCNC2)cc1.Cl.Cl
Standard InChI: InChI=1S/C25H35N3O2.2ClH/c1-4-27(5-2)19-20-10-12-22(13-11-20)25(29)28(23-14-16-26-18-23)17-15-21-8-6-7-9-24(21)30-3;;/h6-13,23,26H,4-5,14-19H2,1-3H3;2*1H/t23-;;/m1../s1
Standard InChI Key: GSUZWFZKTIOWTI-MQWQBNKOSA-N
Molfile:
RDKit 2D
32 32 0 0 0 0 0 0 0 0999 V2000
3.0583 -13.1082 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.6527 -14.1123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6516 -14.9396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3663 -15.3525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0828 -14.9391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0799 -14.1086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3645 -13.6995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3621 -12.8745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6463 -12.4642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6439 -11.6392 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3571 -11.2246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3547 -10.3996 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0728 -11.6349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7928 -13.6934 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5088 -14.1033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9282 -11.2288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0705 -12.4592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7853 -12.8695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4995 -12.4548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4943 -11.6256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7790 -11.2190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8355 -10.4127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0281 -10.2436 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6177 -10.9593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1717 -11.5706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2157 -12.8643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9284 -12.4486 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6446 -12.8581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9248 -11.6236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6375 -11.2081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3573 -12.4425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5832 -14.0748 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
11 13 1 0
6 14 1 0
14 15 1 0
16 10 1 6
13 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 13 1 0
16 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 16 1 0
19 26 1 0
26 27 1 0
27 28 1 0
27 29 1 0
29 30 1 0
28 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 409.57Molecular Weight (Monoisotopic): 409.2729AlogP: 3.58#Rotatable Bonds: 10Polar Surface Area: 44.81Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 10.42CX LogP: 3.37CX LogD: -1.13Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.65Np Likeness Score: -1.10