(E)-N-(5-(3-(6-bromobenzo[d][1,3]dioxol-5-yl)acryloyl)-4-methylthiazol-2-yl)benzamide

ID: ALA4568577

PubChem CID: 155560482

Max Phase: Preclinical

Molecular Formula: C21H15BrN2O4S

Molecular Weight: 471.33

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1nc(NC(=O)c2ccccc2)sc1C(=O)/C=C/c1cc2c(cc1Br)OCO2

Standard InChI:  InChI=1S/C21H15BrN2O4S/c1-12-19(29-21(23-12)24-20(26)13-5-3-2-4-6-13)16(25)8-7-14-9-17-18(10-15(14)22)28-11-27-17/h2-10H,11H2,1H3,(H,23,24,26)/b8-7+

Standard InChI Key:  FHVIYLBVCNMPPN-BQYQJAHWSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   18.8844   -9.2089    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.2110   -9.6956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4677  -10.4839    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.2970  -10.4839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5537   -9.6956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7816  -11.1516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2637   -9.2755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9826   -9.6804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2549   -8.4506    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.6926   -9.2602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4115   -9.6650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4927   -9.2797    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.7777   -9.6913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0637   -9.2780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7767  -10.5164    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.0677   -8.4541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3545   -8.0408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6385   -8.4525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6401   -9.2818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3539   -9.6914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4157  -10.4892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1337  -10.8939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1146   -9.2434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8333   -9.6445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8473  -10.4717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6383  -10.7141    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.1134  -10.0366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6157   -9.3756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.7044  -10.9072    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  1  2  1  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  4  6  1  0
  5  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  2  0
 10 11  1  0
  2 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  2  0
 14 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 14  1  0
 11 21  2  0
 21 22  1  0
 22 25  2  0
 24 23  2  0
 23 11  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 24  1  0
 21 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4568577

    ---

Associated Targets(Human)

ALOX5 Tclin Arachidonate 5-lipoxygenase (6568 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 471.33Molecular Weight (Monoisotopic): 469.9936AlogP: 5.09#Rotatable Bonds: 5
Polar Surface Area: 77.52Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.75CX Basic pKa: CX LogP: 4.98CX LogD: 4.98
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.41Np Likeness Score: -1.23

References

1. Sinha S, Manju SL, Doble M..  (2019)  Chalcone-Thiazole Hybrids: Rational Design, Synthesis, and Lead Identification against 5-Lipoxygenase.,  10  (10): [PMID:31620227] [10.1021/acsmedchemlett.9b00193]

Source