The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(3-isopropyl-1H-pyrazol-5-yl)phenyl)-3-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)benzamide ID: ALA4568629
PubChem CID: 155560669
Max Phase: Preclinical
Molecular Formula: C25H28F3N5O
Molecular Weight: 471.53
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)c1cc(-c2cccc(NC(=O)c3cc(N4CCN(C)CC4)cc(C(F)(F)F)c3)c2)[nH]n1
Standard InChI: InChI=1S/C25H28F3N5O/c1-16(2)22-15-23(31-30-22)17-5-4-6-20(12-17)29-24(34)18-11-19(25(26,27)28)14-21(13-18)33-9-7-32(3)8-10-33/h4-6,11-16H,7-10H2,1-3H3,(H,29,34)(H,30,31)
Standard InChI Key: LBPACMVSPCBJSN-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
4.3446 -8.5763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3434 -9.3959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0515 -9.8048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7611 -9.3954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7583 -8.5727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0497 -8.1675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6381 -9.8072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8918 -9.4742 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3445 -10.0811 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7526 -10.7892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5520 -10.6198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4695 -9.8029 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1765 -9.3932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1752 -8.5760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4197 -11.5355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6069 -11.6203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8995 -12.1970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8816 -9.7980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8815 -10.6163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5891 -11.0237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2971 -10.6140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2932 -9.7925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5851 -9.3888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0004 -9.3760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6425 -9.0009 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.8002 -9.6754 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.1324 -8.5323 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.5931 -11.8376 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8840 -12.2457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8830 -13.0594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5893 -13.4710 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2984 -13.0629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3011 -12.2431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5871 -14.2882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 7 2 0
2 7 1 0
4 12 1 0
12 13 1 0
13 14 2 0
10 15 1 0
15 16 1 0
15 17 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
13 18 1 0
24 25 1 0
24 26 1 0
24 27 1 0
22 24 1 0
28 29 1 0
28 33 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
20 28 1 0
31 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 471.53Molecular Weight (Monoisotopic): 471.2246AlogP: 5.22#Rotatable Bonds: 5Polar Surface Area: 64.26Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.60CX LogP: 5.14CX LogD: 4.73Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.54Np Likeness Score: -1.90
References 1. Jung H, Kim J, Im D, Moon H, Hah JM.. (2019) Design, synthesis, and in vitro evaluation of N-(3-(3-alkyl-1H-pyrazol-5-yl) phenyl)-aryl amide for selective RAF inhibition., 29 (4): [PMID:30630714 ] [10.1016/j.bmcl.2019.01.003 ]