The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(4-(3,4-Difluorophenyl)-1H-1,2,3-triazol-1-yl)-4'-(piperidin-4-yl)-[1,1'-biphenyl]-3-carboxylic Acid ID: ALA4568641
PubChem CID: 135356790
Max Phase: Preclinical
Molecular Formula: C26H22F2N4O2
Molecular Weight: 460.48
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1cc(-c2ccc(C3CCNCC3)cc2)cc(-n2cc(-c3ccc(F)c(F)c3)nn2)c1
Standard InChI: InChI=1S/C26H22F2N4O2/c27-23-6-5-19(14-24(23)28)25-15-32(31-30-25)22-12-20(11-21(13-22)26(33)34)17-3-1-16(2-4-17)18-7-9-29-10-8-18/h1-6,11-15,18,29H,7-10H2,(H,33,34)
Standard InChI Key: GGEWYSIJGICGIF-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
13.5785 -11.1078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3939 -11.1089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8009 -10.4045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3935 -9.6984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5749 -9.7012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1717 -10.4062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6143 -10.4021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0221 -11.1116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8385 -11.1121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2481 -10.4040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8353 -9.6938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0202 -9.6968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0635 -10.4010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4717 -11.1100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2853 -11.1111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6970 -10.4048 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.2888 -9.6957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4690 -9.6930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1637 -8.9950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5696 -8.2858 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3465 -8.9981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1707 -11.8194 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3580 -11.9050 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.1883 -12.7044 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8961 -13.1128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5032 -12.5658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9802 -13.9229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3176 -14.4030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4028 -15.2149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1501 -15.5478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8129 -15.0627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7244 -14.2524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7416 -15.6952 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.2369 -16.3604 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
3 7 1 0
13 14 1 0
13 18 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
10 13 1 0
5 19 1 0
19 20 1 0
19 21 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 22 1 0
1 22 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
25 27 1 0
29 33 1 0
30 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.48Molecular Weight (Monoisotopic): 460.1711AlogP: 5.04#Rotatable Bonds: 5Polar Surface Area: 80.04Molecular Species: ZWITTERIONHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.85CX Basic pKa: 10.07CX LogP: 2.93CX LogD: 2.93Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.44Np Likeness Score: -1.25
References 1. Junker A, Balasubramanian R, Ciancetta A, Uliassi E, Kiselev E, Martiriggiano C, Trujillo K, Mtchedlidze G, Birdwell L, Brown KA, Harden TK, Jacobson KA.. (2016) Structure-Based Design of 3-(4-Aryl-1H-1,2,3-triazol-1-yl)-Biphenyl Derivatives as P2Y14 Receptor Antagonists., 59 (13): [PMID:27331270 ] [10.1021/acs.jmedchem.6b00044 ]