The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Trapoxin B ID: ALA4568666
PubChem CID: 155560271
Max Phase: Preclinical
Molecular Formula: C34H42N4O6
Molecular Weight: 602.73
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C1C[C@H]2CCCN2C(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](CCCCCC(=O)[C@@H]2CO2)N1
Standard InChI: InChI=1S/C34H42N4O6/c39-29(30-22-44-30)17-9-3-8-16-26-32(41)36-27(19-23-11-4-1-5-12-23)33(42)37-28(20-24-13-6-2-7-14-24)34(43)38-18-10-15-25(38)21-31(40)35-26/h1-2,4-7,11-14,25-28,30H,3,8-10,15-22H2,(H,35,40)(H,36,41)(H,37,42)/t25-,26+,27+,28+,30+/m1/s1
Standard InChI Key: TUJYSRGFWBQJNM-QUBFWBSFSA-N
Molfile:
RDKit 2D
45 49 0 0 0 0 0 0 0 0999 V2000
16.7178 -4.9321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4170 -4.5281 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.0128 -4.5276 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7178 -5.7451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0128 -6.1496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4186 -6.1496 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.4186 -6.9626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1236 -7.3671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7178 -7.3671 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1236 -8.1802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8244 -6.9626 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.3120 -5.7451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3124 -4.9346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6128 -4.5261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9064 -4.9348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9104 -5.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6108 -6.1530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8195 -3.8148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6283 -3.8019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4045 -3.1184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7983 -2.4092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6114 -2.4026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0051 -1.6947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5900 -0.9968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7748 -1.0096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3826 -1.7184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0517 -4.6261 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0263 -3.0927 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.6184 -5.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3275 -5.8548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5238 -6.5498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2005 -7.0013 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8244 -8.5846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5294 -8.1802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2302 -8.5846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9352 -8.1802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6360 -8.5846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3410 -8.1802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6360 -9.3977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.1487 -8.1774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7442 -7.4725 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4442 -3.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2531 -3.7962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4585 -4.6889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1926 -5.6409 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
4 5 1 1
4 6 1 0
6 7 1 0
7 8 1 0
7 9 2 0
8 10 1 1
8 11 1 0
5 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
2 18 1 0
18 19 1 0
18 20 1 1
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
19 27 1 0
19 28 2 0
27 29 1 0
29 30 1 0
11 31 1 0
31 30 1 0
31 32 2 0
10 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
38 37 1 1
37 39 2 0
40 38 1 0
41 40 1 0
38 41 1 0
27 42 1 0
42 43 1 0
43 44 1 0
29 44 1 0
29 45 1 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 602.73Molecular Weight (Monoisotopic): 602.3104AlogP: 2.24#Rotatable Bonds: 11Polar Surface Area: 137.21Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.84CX Basic pKa: ┄CX LogP: 2.70CX LogD: 2.70Aromatic Rings: 2Heavy Atoms: 44QED Weighted: 0.27Np Likeness Score: 0.71
References 1. Sangwan R, Rajan R, Mandal PK.. (2018) HDAC as onco target: Reviewing the synthetic approaches with SAR study of their inhibitors., 158 [PMID:30245394 ] [10.1016/j.ejmech.2018.08.073 ]