N-(5-Chloro-2-methoxybenzyl)-N-(4-(N-(prop-2-yn-1-yl)sulfamoyl)phenethyl)hexanamide

ID: ALA4568669

PubChem CID: 155560273

Max Phase: Preclinical

Molecular Formula: C25H31ClN2O4S

Molecular Weight: 491.05

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C#CCNS(=O)(=O)c1ccc(CCN(Cc2cc(Cl)ccc2OC)C(=O)CCCCC)cc1

Standard InChI:  InChI=1S/C25H31ClN2O4S/c1-4-6-7-8-25(29)28(19-21-18-22(26)11-14-24(21)32-3)17-15-20-9-12-23(13-10-20)33(30,31)27-16-5-2/h2,9-14,18,27H,4,6-8,15-17,19H2,1,3H3

Standard InChI Key:  WALSEPKPGBCNSI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 34  0  0  0  0  0  0  0  0999 V2000
   36.4892   -5.6106    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.0819   -4.8957    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   35.6659   -5.6079    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.3666   -3.6673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6522   -3.2513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9383   -3.6645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9377   -4.4895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6568   -4.8996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3677   -4.4881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2218   -3.2483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5048   -3.6634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7924   -3.2472    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.0753   -3.6623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3588   -3.2462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3630   -2.4194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6474   -2.0075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9293   -2.4184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9313   -3.2498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6475   -3.6621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6502   -4.4891    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.8014   -4.4846    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.8030   -3.6576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5206   -3.2434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2305   -2.8260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7941   -2.4245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0823   -2.0115    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.5076   -2.0144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2193   -2.4273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9328   -2.0173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6447   -2.4302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3581   -2.0202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3643   -4.8981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6484   -1.1846    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  6 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 19 20  1  0
  9  2  1  0
  2 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  3  0
 12 25  1  0
 25 26  2  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 20 32  1  0
 16 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4568669

    ---

Associated Targets(non-human)

Nlrp3 NACHT, LRR and PYD domains-containing protein 3 (641 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 491.05Molecular Weight (Monoisotopic): 490.1693AlogP: 4.41#Rotatable Bonds: 13
Polar Surface Area: 75.71Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.13CX Basic pKa: CX LogP: 4.69CX LogD: 4.69
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.33Np Likeness Score: -1.50

References

1. Jiang Y, He L, Green J, Blevins H, Guo C, Patel SH, Halquist MS, McRae M, Venitz J, Wang XY, Zhang S..  (2019)  Discovery of Second-Generation NLRP3 Inflammasome Inhibitors: Design, Synthesis, and Biological Characterization.,  62  (21): [PMID:31626545] [10.1021/acs.jmedchem.9b01155]

Source