Ethyl 2-(3-(4-fluorobenzamido)phenyl)-4-((4-morpholinophenyl)amino)thiazole-5-carboxylate

ID: ALA4568697

PubChem CID: 155560427

Max Phase: Preclinical

Molecular Formula: C29H27FN4O4S

Molecular Weight: 546.62

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)c1sc(-c2cccc(NC(=O)c3ccc(F)cc3)c2)nc1Nc1ccc(N2CCOCC2)cc1

Standard InChI:  InChI=1S/C29H27FN4O4S/c1-2-38-29(36)25-26(31-22-10-12-24(13-11-22)34-14-16-37-17-15-34)33-28(39-25)20-4-3-5-23(18-20)32-27(35)19-6-8-21(30)9-7-19/h3-13,18,31H,2,14-17H2,1H3,(H,32,35)

Standard InChI Key:  AOQTYPWBJXUOQT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
    1.6860  -10.9039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6849  -11.7314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3997  -12.1442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1161  -11.7309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1132  -10.9003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3979  -10.4912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8262  -10.4852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5421  -10.8950    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8230   -9.6602    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2551  -10.4797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9695  -10.8930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6819  -10.4785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6792   -9.6526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9582   -9.2431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2487   -9.6599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3977  -10.8886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4833  -11.7069    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2909  -11.8758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7009  -11.1600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1469  -10.5488    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.6288  -12.6283    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4496  -12.7119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7843  -13.4630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6042  -13.5468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0878  -12.8774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7456  -12.1221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9266  -12.0419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5225  -11.0684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0097  -11.7342    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8555  -10.3136    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6757  -10.2246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0087   -9.4698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9074  -12.9584    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2450  -13.7122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0620  -13.7962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5476  -13.1288    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2099  -12.3749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3869  -12.2886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9701  -12.1433    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
 12 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 16  1  0
 18 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 28 29  2  0
 28 30  1  0
 19 28  1  0
 30 31  1  0
 31 32  1  0
 33 34  1  0
 33 38  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 25 33  1  0
  2 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4568697

    ---

Associated Targets(Human)

Raji (5516 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Ramos (1218 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BTK Tclin Tyrosine-protein kinase BTK (8973 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 546.62Molecular Weight (Monoisotopic): 546.1737AlogP: 5.96#Rotatable Bonds: 8
Polar Surface Area: 92.79Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 2.38CX LogP: 7.61CX LogD: 7.61
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.26Np Likeness Score: -1.98

References

1. Guo X, Yang D, Fan Z, Zhang N, Zhao B, Huang C, Wang F, Ma R, Meng M, Deng Y..  (2019)  Discovery and structure-activity relationship of novel diphenylthiazole derivatives as BTK inhibitor with potent activity against B cell lymphoma cell lines.,  178  [PMID:31234030] [10.1016/j.ejmech.2019.06.035]

Source