The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(4-Methoxybenzamido)-4'-(piperidin-4-yl)-[1,1'-biphenyl]-3-carboxylic acid ID: ALA4568716
PubChem CID: 155560488
Max Phase: Preclinical
Molecular Formula: C26H26N2O4
Molecular Weight: 430.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C(=O)Nc2cc(C(=O)O)cc(-c3ccc(C4CCNCC4)cc3)c2)cc1
Standard InChI: InChI=1S/C26H26N2O4/c1-32-24-8-6-20(7-9-24)25(29)28-23-15-21(14-22(16-23)26(30)31)18-4-2-17(3-5-18)19-10-12-27-13-11-19/h2-9,14-16,19,27H,10-13H2,1H3,(H,28,29)(H,30,31)
Standard InChI Key: CSVCDUBJIZZCOW-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
5.4571 -13.2253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4559 -14.0526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1707 -14.4655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8871 -14.0521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8843 -13.2216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1689 -12.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1724 -15.2883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4562 -15.7001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4556 -16.5244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1705 -16.9378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8874 -16.5210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8845 -15.6981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1751 -17.7602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4592 -18.1722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4582 -18.9936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1712 -19.4092 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8871 -18.9972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8899 -18.1696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5972 -12.8064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3133 -13.2163 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5941 -11.9814 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7424 -12.8130 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0280 -13.2256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3134 -12.8133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0282 -14.0506 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3170 -11.9876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6032 -11.5754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8878 -11.9881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8906 -12.8174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6050 -13.2259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1727 -11.5767 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1714 -10.7517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
3 7 1 0
13 14 1 0
13 18 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
10 13 1 0
5 19 1 0
19 20 2 0
19 21 1 0
1 22 1 0
22 23 1 0
23 24 1 0
23 25 2 0
24 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 24 1 0
28 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 430.50Molecular Weight (Monoisotopic): 430.1893AlogP: 4.78#Rotatable Bonds: 6Polar Surface Area: 87.66Molecular Species: ZWITTERIONHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.84CX Basic pKa: 10.07CX LogP: 1.85CX LogD: 1.84Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.52Np Likeness Score: -0.69
References 1. Zhang Z, Hao K, Li H, Lu R, Liu C, Zhou M, Li B, Meng Z, Hu Q, Jiang C.. (2019) Design, synthesis and anti-inflammatory evaluation of 3-amide benzoic acid derivatives as novel P2Y14 receptor antagonists., 181 [PMID:31376563 ] [10.1016/j.ejmech.2019.111564 ]