The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-bromo-3-(2-(2-((9-methyl-9H-carbazol-3-yl)methylene)hydrazinyl)thiazol-4-yl)-2H-chromen-2-one ID: ALA4568877
PubChem CID: 155560279
Max Phase: Preclinical
Molecular Formula: C26H17BrN4O2S
Molecular Weight: 529.42
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cn1c2ccccc2c2cc(/C=N/Nc3nc(-c4cc5cc(Br)ccc5oc4=O)cs3)ccc21
Standard InChI: InChI=1S/C26H17BrN4O2S/c1-31-22-5-3-2-4-18(22)19-10-15(6-8-23(19)31)13-28-30-26-29-21(14-34-26)20-12-16-11-17(27)7-9-24(16)33-25(20)32/h2-14H,1H3,(H,29,30)/b28-13+
Standard InChI Key: QYOWQMYSACYPOA-XODNFHPESA-N
Molfile:
RDKit 2D
34 39 0 0 0 0 0 0 0 0999 V2000
35.9467 -8.0233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9456 -8.8428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6536 -9.2518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6519 -7.6144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3605 -8.0197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3607 -8.8383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1394 -9.0911 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.1390 -7.7665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6186 -8.4267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4282 -8.3406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7592 -7.5950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2745 -6.9347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4666 -7.0241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6030 -6.1865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4153 -6.0969 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.7438 -5.3486 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.3934 -9.8678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5561 -5.2590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1010 -5.8632 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
42.8459 -5.5270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7563 -4.7147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9561 -4.5490 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.3607 -4.1647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.1434 -4.4166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.7465 -3.8705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.1889 -3.3693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3156 -5.2155 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.8000 -2.8220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.5798 -3.0747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.1865 -2.5263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.0147 -1.7251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.2307 -1.4751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6274 -2.0252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0561 -0.6768 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 9 1 0
8 5 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
12 14 1 0
14 15 2 0
15 16 1 0
7 17 1 0
16 18 1 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 18 2 0
21 23 1 0
23 24 1 0
23 26 2 0
24 25 1 0
25 29 1 0
28 26 1 0
24 27 2 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
32 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 529.42Molecular Weight (Monoisotopic): 528.0256AlogP: 6.77#Rotatable Bonds: 4Polar Surface Area: 72.42Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.60CX Basic pKa: 4.90CX LogP: 7.12CX LogD: 7.11Aromatic Rings: 6Heavy Atoms: 34QED Weighted: 0.16Np Likeness Score: -1.28
References 1. Shaikh MS, Kanhed AM, Chandrasekaran B, Palkar MB, Agrawal N, Lherbet C, Hampannavar GA, Karpoormath R.. (2019) Discovery of novel N-methyl carbazole tethered rhodanine derivatives as direct inhibitors of Mycobacterium tuberculosis InhA., 29 (16): [PMID:31227345 ] [10.1016/j.bmcl.2019.06.015 ]