6-bromo-3-(2-(2-((9-methyl-9H-carbazol-3-yl)methylene)hydrazinyl)thiazol-4-yl)-2H-chromen-2-one

ID: ALA4568877

PubChem CID: 155560279

Max Phase: Preclinical

Molecular Formula: C26H17BrN4O2S

Molecular Weight: 529.42

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cn1c2ccccc2c2cc(/C=N/Nc3nc(-c4cc5cc(Br)ccc5oc4=O)cs3)ccc21

Standard InChI:  InChI=1S/C26H17BrN4O2S/c1-31-22-5-3-2-4-18(22)19-10-15(6-8-23(19)31)13-28-30-26-29-21(14-34-26)20-12-16-11-17(27)7-9-24(16)33-25(20)32/h2-14H,1H3,(H,29,30)/b28-13+

Standard InChI Key:  QYOWQMYSACYPOA-XODNFHPESA-N

Molfile:  

 
     RDKit          2D

 34 39  0  0  0  0  0  0  0  0999 V2000
   35.9467   -8.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9456   -8.8428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6536   -9.2518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6519   -7.6144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3605   -8.0197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3607   -8.8383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1394   -9.0911    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.1390   -7.7665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6186   -8.4267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4282   -8.3406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7592   -7.5950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2745   -6.9347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4666   -7.0241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6030   -6.1865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4153   -6.0969    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.7438   -5.3486    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.3934   -9.8678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5561   -5.2590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1010   -5.8632    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   42.8459   -5.5270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7563   -4.7147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9561   -4.5490    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.3607   -4.1647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1434   -4.4166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.7465   -3.8705    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.1889   -3.3693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.3156   -5.2155    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.8000   -2.8220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.5798   -3.0747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.1865   -2.5263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.0147   -1.7251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2307   -1.4751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.6274   -2.0252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.0561   -0.6768    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  9  1  0
  8  5  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
 12 14  1  0
 14 15  2  0
 15 16  1  0
  7 17  1  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 18  2  0
 21 23  1  0
 23 24  1  0
 23 26  2  0
 24 25  1  0
 25 29  1  0
 28 26  1  0
 24 27  2  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 32 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4568877

    ---

Associated Targets(non-human)

inhA Enoyl-[acyl-carrier-protein] reductase (1329 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 529.42Molecular Weight (Monoisotopic): 528.0256AlogP: 6.77#Rotatable Bonds: 4
Polar Surface Area: 72.42Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.60CX Basic pKa: 4.90CX LogP: 7.12CX LogD: 7.11
Aromatic Rings: 6Heavy Atoms: 34QED Weighted: 0.16Np Likeness Score: -1.28

References

1. Shaikh MS, Kanhed AM, Chandrasekaran B, Palkar MB, Agrawal N, Lherbet C, Hampannavar GA, Karpoormath R..  (2019)  Discovery of novel N-methyl carbazole tethered rhodanine derivatives as direct inhibitors of Mycobacterium tuberculosis InhA.,  29  (16): [PMID:31227345] [10.1016/j.bmcl.2019.06.015]

Source