The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-Hydroxyethyl)-2-imino-10-methyl-5-oxo-1-(2-(thiophen-2-yl)ethyl)-1,5-dihydro-2H-dipyrido[1,2-a:2',3'-d]pyrimidine-3-carboxamide ID: ALA4568900
PubChem CID: 155550682
Max Phase: Preclinical
Molecular Formula: C21H21N5O3S
Molecular Weight: 423.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cccn2c(=O)c3cc(C(=O)NCCO)c(=N)n(CCc4cccs4)c3nc12
Standard InChI: InChI=1S/C21H21N5O3S/c1-13-4-2-8-26-18(13)24-19-16(21(26)29)12-15(20(28)23-7-10-27)17(22)25(19)9-6-14-5-3-11-30-14/h2-5,8,11-12,22,27H,6-7,9-10H2,1H3,(H,23,28)
Standard InChI Key: NHRVAZLLKLGJSP-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
1.6963 -5.4191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6963 -6.2404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4057 -6.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4057 -5.0063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1151 -5.4191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1161 -6.2404 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8246 -6.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8225 -5.0073 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5313 -5.4172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5316 -6.2405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2414 -6.6517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9554 -6.2400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9551 -5.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2408 -5.0052 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4057 -4.1850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8238 -7.4713 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6672 -5.0086 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6668 -6.6535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6660 -7.4748 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3791 -6.2415 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0905 -6.6549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2394 -4.1838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9505 -3.7699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9491 -2.9486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6100 -2.4643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3548 -1.6836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5335 -1.6850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2811 -2.4666 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.8045 -6.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5141 -6.6626 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 2 0
2 3 2 0
3 6 1 0
5 4 1 0
5 6 1 0
5 8 2 0
6 7 1 0
7 10 1 0
9 8 1 0
9 10 2 0
9 14 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
4 15 1 0
7 16 2 0
13 17 2 0
12 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
14 22 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 24 1 0
21 29 1 0
29 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 423.50Molecular Weight (Monoisotopic): 423.1365AlogP: 1.46#Rotatable Bonds: 6Polar Surface Area: 112.48Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.30CX LogP: 1.06CX LogD: 0.81Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.41Np Likeness Score: -1.88
References 1. Dong Z, Wang Z, Guo ZQ, Gong S, Zhang T, Liu J, Luo C, Jiang H, Yang CG.. (2020) Structure-Activity Relationship of SPOP Inhibitors against Kidney Cancer., 63 (9): [PMID:32297747 ] [10.1021/acs.jmedchem.0c00161 ]