The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-((3,5-Bis(trifluoromethyl)phenyl)carbamothioyl)-2-(2-fluorobenzamido)-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxamide ID: ALA4569048
PubChem CID: 155550837
Max Phase: Preclinical
Molecular Formula: C24H17F7N4O2S2
Molecular Weight: 590.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)c1c(NC(=O)c2ccccc2F)sc2c1CCN(C(=S)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C2
Standard InChI: InChI=1S/C24H17F7N4O2S2/c25-16-4-2-1-3-14(16)20(37)34-21-18(19(32)36)15-5-6-35(10-17(15)39-21)22(38)33-13-8-11(23(26,27)28)7-12(9-13)24(29,30)31/h1-4,7-9H,5-6,10H2,(H2,32,36)(H,33,38)(H,34,37)
Standard InChI Key: WSBXHCJZGYKEGR-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
32.4318 -27.5988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4318 -28.4201 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.1412 -28.8246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1412 -27.1819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8506 -27.5988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8550 -28.4166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6344 -28.6638 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
35.1091 -27.9987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6272 -27.3432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9304 -27.9942 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.3470 -28.7038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1683 -28.6993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9382 -29.4179 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.8754 -26.5605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3211 -25.9521 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.6779 -26.3820 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.7252 -28.8306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5774 -29.4096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3980 -29.4055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8055 -28.6914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3865 -27.9801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5674 -27.9877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0164 -28.4239 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.3098 -28.8344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6025 -28.4262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8964 -28.8360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8981 -29.6541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6119 -30.0606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3151 -29.6484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7274 -29.6478 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
37.1511 -27.2845 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
28.1878 -28.4290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1859 -27.6118 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.4810 -28.8392 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.4750 -28.0198 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
29.6170 -30.8777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9119 -31.2907 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.3273 -31.2819 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
29.6129 -31.6930 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
8 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
9 14 1 0
14 15 2 0
14 16 1 0
2 17 1 0
12 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 12 1 0
17 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
17 30 2 0
22 31 1 0
26 32 1 0
32 33 1 0
32 34 1 0
32 35 1 0
28 36 1 0
36 37 1 0
36 38 1 0
36 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 590.55Molecular Weight (Monoisotopic): 590.0681AlogP: 6.03#Rotatable Bonds: 4Polar Surface Area: 87.46Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.39CX Basic pKa: ┄CX LogP: 6.55CX LogD: 6.55Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.26Np Likeness Score: -2.03
References 1. Wang G, Zhao Y, Liu Y, Sun D, Zhen Y, Liu J, Fu L, Zhang L, Ouyang L.. (2020) Discovery of a Novel Dual-Target Inhibitor of ERK1 and ERK5 That Induces Regulated Cell Death to Overcome Compensatory Mechanism in Specific Tumor Types., 63 (8): [PMID:32078308 ] [10.1021/acs.jmedchem.9b01896 ]