2-(cyclopentylmethyl)-1-(p-tolylmethyl)benzimidazole

ID: ALA4569236

PubChem CID: 155560238

Max Phase: Preclinical

Molecular Formula: C21H24N2

Molecular Weight: 304.44

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(Cn2c(CC3CCCC3)nc3ccccc32)cc1

Standard InChI:  InChI=1S/C21H24N2/c1-16-10-12-18(13-11-16)15-23-20-9-5-4-8-19(20)22-21(23)14-17-6-2-3-7-17/h4-5,8-13,17H,2-3,6-7,14-15H2,1H3

Standard InChI Key:  GLGVAVNXWBWOMB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 26  0  0  0  0  0  0  0  0999 V2000
    1.3068   -5.4061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0204   -4.9957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7301   -5.4055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7301   -6.2315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0230   -6.6453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3068   -6.2367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5190   -6.4878    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0002   -5.8207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5191   -5.1535    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8260   -5.8207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2411   -5.1029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9030   -4.3504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5170   -3.7986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2302   -4.2133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0599   -5.0171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7286   -7.2859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1483   -7.8663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3618   -8.6646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7790   -9.2457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9806   -9.0319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7661   -8.2400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3452   -7.6512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3961   -9.6163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  4  7  1  0
  8  7  1  0
  9  8  2  0
  3  9  1  0
  8 10  1  0
 10 11  1  0
 12 11  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
  7 16  1  0
 16 17  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 17 22  1  0
 20 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4569236

    ---

Associated Targets(non-human)

Hmox1 Heme oxygenase 1 (289 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Hmox2 Heme oxygenase 2 (264 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 304.44Molecular Weight (Monoisotopic): 304.1939AlogP: 5.13#Rotatable Bonds: 4
Polar Surface Area: 17.82Molecular Species: NEUTRALHBA: 2HBD:
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 5.69CX LogP: 5.70CX LogD: 5.69
Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.65Np Likeness Score: -1.29

References

1. Intagliata S, Salerno L, Ciaffaglione V, Leonardi C, Fallica AN, Carota G, Amata E, Marrazzo A, Pittalà V, Romeo G..  (2019)  Heme Oxygenase-2 (HO-2) as a therapeutic target: Activators and inhibitors.,  183  [PMID:31550661] [10.1016/j.ejmech.2019.111703]

Source