The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-((5-chloro-4-((3-methoxy-4-morpholinophenyl)amino)pyrimidin-2-yl)amino)-3-methoxyphenyl)-1-methyl-1-(pyridin-3-ylmethyl)urea ID: ALA4569257
PubChem CID: 155560392
Max Phase: Preclinical
Molecular Formula: C30H33ClN8O4
Molecular Weight: 605.10
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(NC(=O)N(C)Cc2cccnc2)ccc1Nc1ncc(Cl)c(Nc2ccc(N3CCOCC3)c(OC)c2)n1
Standard InChI: InChI=1S/C30H33ClN8O4/c1-38(19-20-5-4-10-32-17-20)30(40)35-22-6-8-24(26(15-22)41-2)36-29-33-18-23(31)28(37-29)34-21-7-9-25(27(16-21)42-3)39-11-13-43-14-12-39/h4-10,15-18H,11-14,19H2,1-3H3,(H,35,40)(H2,33,34,36,37)
Standard InChI Key: OMPWEEDIMNWBIN-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 47 0 0 0 0 0 0 0 0999 V2000
19.5682 -2.7701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2774 -3.1760 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.9836 -2.7648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6888 -3.1725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3945 -2.7619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3919 -1.9438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6777 -1.5381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9749 -1.9510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5651 -1.9529 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.1036 -3.1681 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.1062 -3.9853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0975 -1.5316 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.8073 -1.9366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8073 -2.7539 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.5162 -3.1588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2228 -2.7466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2160 -1.9252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5065 -1.5240 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.9331 -3.1506 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
25.9202 -1.5105 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.6314 -1.9130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6332 -2.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3435 -3.1316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3280 -1.4968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0390 -1.8955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0499 -2.7168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7582 -3.1159 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.7647 -3.9340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4726 -4.3352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1784 -3.9228 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.1719 -3.1046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4595 -2.6990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7413 -1.4778 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.7308 -0.6607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8620 -3.1814 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.1528 -2.7755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8651 -3.9986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1589 -4.4098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4514 -4.0027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7457 -4.4133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7483 -5.2313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4625 -5.6371 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.1653 -5.2242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
1 9 2 0
5 10 1 0
10 11 1 0
6 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
16 19 1 0
17 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 26 2 0
25 24 2 0
24 21 1 0
25 26 1 0
27 28 1 0
27 32 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
26 27 1 0
25 33 1 0
33 34 1 0
1 35 1 0
35 36 1 0
35 37 1 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 42 1 0
42 43 2 0
43 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 605.10Molecular Weight (Monoisotopic): 604.2313AlogP: 5.53#Rotatable Bonds: 10Polar Surface Area: 126.00Molecular Species: NEUTRALHBA: 10HBD: 3#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 3#RO5 Violations (Lipinski): 3CX Acidic pKa: 12.75CX Basic pKa: 4.81CX LogP: 4.24CX LogD: 4.24Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.21Np Likeness Score: -1.91
References 1. Chen H, Li R, Ning X, Zhao X, Jin Y, Yin Y.. (2019) Synthesis and anti-tumor efficacy of novel 2, 4-diarylaminopyrimidine derivatives bearing N-(3-pyridinylmethyl) urea moiety as anaplastic lymphoma kinase inhibitors., 178 [PMID:31177074 ] [10.1016/j.ejmech.2019.05.060 ]