The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4569343
PubChem CID: 155560397
Max Phase: Preclinical
Molecular Formula: C33H45ClN4O2
Molecular Weight: 565.20
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@@H](CN1CCCC1=O)C(=O)NCCCCCCCNc1c2c(nc3cc(Cl)ccc13)C[C@H]1C=C(C)C[C@@H]2C1
Standard InChI: InChI=1S/C33H45ClN4O2/c1-3-24(21-38-15-9-10-30(38)39)33(40)36-14-8-6-4-5-7-13-35-32-27-12-11-26(34)20-28(27)37-29-19-23-16-22(2)17-25(18-23)31(29)32/h11-12,16,20,23-25H,3-10,13-15,17-19,21H2,1-2H3,(H,35,37)(H,36,40)/t23-,24-,25+/m0/s1
Standard InChI Key: GJARULZXVOTKRA-CCDWMCETSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
39.0878 -7.4842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7996 -7.0627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7906 -6.2349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0738 -5.8325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3747 -7.0761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3678 -6.2510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6544 -5.8462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9431 -6.2654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9541 -7.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6681 -7.4947 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.5162 -7.4716 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
37.6466 -5.0241 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.3556 -4.6063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3478 -3.7841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0568 -3.3663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0490 -2.5399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7579 -2.1221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4747 -2.5307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1836 -2.1086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9003 -2.5172 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.6092 -2.0994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3217 -2.5037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6014 -1.2730 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.3295 -3.3258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0462 -3.7302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0306 -2.0859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.7474 -2.4902 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.8446 -3.3059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.6498 -3.4703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.0541 -2.7535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.4981 -2.1458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.6622 -1.3406 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.3439 -6.4226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1399 -6.0558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4850 -5.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5046 -6.4288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1385 -4.7244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9300 -5.8111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5420 -7.4263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7883 -6.8344 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
36.4709 -5.3004 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
35.3521 -3.9275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
2 11 1 0
7 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
21 23 2 0
22 24 1 6
24 25 1 0
22 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 27 1 0
31 32 2 0
9 33 1 0
8 34 1 0
34 35 1 0
33 36 1 0
35 37 1 0
36 38 1 0
38 37 2 0
34 39 1 0
36 39 1 0
36 40 1 1
34 41 1 6
37 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 565.20Molecular Weight (Monoisotopic): 564.3231AlogP: 7.01#Rotatable Bonds: 13Polar Surface Area: 74.33Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 7.96CX LogP: 5.47CX LogD: 4.83Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.20Np Likeness Score: -0.41
References 1. Wang T, Liu XH, Guan J, Ge S, Wu MB, Lin JP, Yang LR.. (2019) Advancement of multi-target drug discoveries and promising applications in the field of Alzheimer's disease., 169 [PMID:30884327 ] [10.1016/j.ejmech.2019.02.076 ]