5(5)-(4-Methyl-1H-imidazol-1-yl)-1(4)H-6-oxa-3-aza-2(2,6)-pyridina-1(3,4)-triazola-5(1,2)-benzenacyclodecaphan-4-one

ID: ALA4569388

PubChem CID: 138458386

Max Phase: Preclinical

Molecular Formula: C22H21N7O2

Molecular Weight: 415.46

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cn(-c2ccc3c(c2)C(=O)Nc2cccc(n2)-c2nncn2CCCCO3)cn1

Standard InChI:  InChI=1S/C22H21N7O2/c1-15-12-29(13-23-15)16-7-8-19-17(11-16)22(30)26-20-6-4-5-18(25-20)21-27-24-14-28(21)9-2-3-10-31-19/h4-8,11-14H,2-3,9-10H2,1H3,(H,25,26,30)

Standard InChI Key:  KDVGNMZWBQXLHL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
    5.2799  -17.6503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9879  -17.2431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6920  -17.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6920  -18.4651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9863  -18.8716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2799  -18.4703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3960  -18.8728    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1041  -18.4651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8080  -18.8728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5161  -18.4651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2241  -18.8728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0135  -18.4592    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.8152  -18.6282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2226  -17.9206    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6750  -17.3155    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9326  -17.6468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2245  -17.2391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2223  -16.4296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5139  -16.0217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8083  -16.4267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8080  -17.2421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1041  -17.6498    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3960  -17.2421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3960  -16.4268    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5204  -17.6523    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5718  -17.2427    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8293  -17.5740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2818  -16.9689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6892  -16.2613    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4867  -16.4302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4697  -16.9689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 12 11  1  0
 13 12  1  0
 14 13  2  0
 15 14  1  0
 16 15  2  0
 12 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 22 21  1  0
 23 22  1  0
  3 23  1  0
 23 24  2  0
 21 25  1  0
 25 17  2  0
 26  1  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 26  1  0
 28 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4569388

    ---

Associated Targets(Human)

MAP3K5 Tchem Mitogen-activated protein kinase kinase kinase 5 (1965 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 415.46Molecular Weight (Monoisotopic): 415.1757AlogP: 3.26#Rotatable Bonds: 1
Polar Surface Area: 99.75Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.92CX LogP: 2.14CX LogD: 2.13
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.51Np Likeness Score: -1.11

References

1. Himmelbauer MK, Xin Z, Jones JH, Enyedy I, King K, Marcotte DJ, Murugan P, Santoro JC, Hesson T, Spilker K, Johnson JL, Luzzio MJ, Gilfillan R, de Turiso FG..  (2019)  Rational Design and Optimization of a Novel Class of Macrocyclic Apoptosis Signal-Regulating Kinase 1 Inhibitors.,  62  (23): [PMID:31710475] [10.1021/acs.jmedchem.9b01206]

Source