Acetic acid (2R,4R,8R,9S,13R)-2-hyroxy-14-(S)-methyl-5,5,9-trimethyl-10,15-dioxo-tricyclo[11.2.1.0(4,9)]hexadec-1(16)-en-8-yl ester

ID: ALA4569395

PubChem CID: 155560718

Max Phase: Preclinical

Molecular Formula: C22H32O5

Molecular Weight: 376.49

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)O[C@@H]1CCC(C)(C)[C@H]2C[C@@H](O)C3=C[C@@H](CCC(=O)[C@@]21C)[C@H](C)C3=O

Standard InChI:  InChI=1S/C22H32O5/c1-12-14-6-7-18(25)22(5)17(11-16(24)15(10-14)20(12)26)21(3,4)9-8-19(22)27-13(2)23/h10,12,14,16-17,19,24H,6-9,11H2,1-5H3/t12-,14+,16+,17+,19+,22+/m0/s1

Standard InChI Key:  WTOYVIVJWKUKIQ-WJBAYVJOSA-N

Molfile:  

 
     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
   11.0156   -9.8641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0197  -10.6813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7253  -10.2691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8132  -10.8696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0642  -11.6470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5193  -12.2540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7703  -13.0313    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5602  -13.2444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1411  -12.6676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7732  -14.0342    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7192  -12.0837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1264  -12.7938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4641  -12.8610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8018  -13.3418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9834  -13.3418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1264  -13.3418    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.4641  -11.3063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8018  -10.8255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9834  -10.8255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3126  -11.2912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0701  -12.0837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3073  -12.8527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9002  -13.5628    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.6334  -12.4641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9057  -12.8814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6334  -11.6870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9148  -11.2709    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2441  -10.4750    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.7392  -10.0457    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  1
  7  8  1  0
  8  9  1  0
  8 10  2  0
  6 11  1  0
 11 12  1  6
 11 13  1  0
 13 14  1  0
 14 15  1  0
 13 16  2  0
 11 17  1  0
  2 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 15 22  1  0
 22 23  1  6
 22 24  1  0
 24 25  1  6
 24 26  1  0
 20 26  1  0
 26 27  2  0
 17 28  1  1
 19 29  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4569395

    ---

Associated Targets(Human)

RIPK3 Tchem Receptor-interacting serine/threonine-protein kinase 3 (468 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 376.49Molecular Weight (Monoisotopic): 376.2250AlogP: 3.24#Rotatable Bonds: 1
Polar Surface Area: 80.67Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.22CX LogD: 3.22
Aromatic Rings: Heavy Atoms: 27QED Weighted: 0.71Np Likeness Score: 2.90

References

1. Zhuang C, Chen F..  (2020)  Small-Molecule Inhibitors of Necroptosis: Current Status and Perspectives.,  63  (4): [PMID:31622096] [10.1021/acs.jmedchem.9b01317]

Source