2-(3-fluoro-4-chlorobenzyl)-6-(2-((tetrahydro-2H-pyran-4-yl)amino)pyrimidin-4-yl)isoindolin-1-one

ID: ALA4569409

PubChem CID: 146634732

Max Phase: Preclinical

Molecular Formula: C24H22ClFN4O2

Molecular Weight: 452.92

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1c2cc(-c3ccnc(NC4CCOCC4)n3)ccc2CN1Cc1ccc(Cl)c(F)c1

Standard InChI:  InChI=1S/C24H22ClFN4O2/c25-20-4-1-15(11-21(20)26)13-30-14-17-3-2-16(12-19(17)23(30)31)22-5-8-27-24(29-22)28-18-6-9-32-10-7-18/h1-5,8,11-12,18H,6-7,9-10,13-14H2,(H,27,28,29)

Standard InChI Key:  YETRTVIDJKZDBJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   32.5046  -15.1304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5035  -15.9499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2115  -16.3589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2097  -14.7215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7989  -14.7221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8000  -13.9038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0931  -13.4955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3845  -13.9043    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.3873  -14.7257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0949  -15.1304    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.9184  -15.1268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9232  -15.9454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7032  -16.1938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1806  -15.5287    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.6954  -14.8693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9434  -14.0907    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.9977  -15.5239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4021  -14.8138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6811  -15.1370    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.6842  -15.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2192  -14.8117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6236  -14.1025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2108  -13.3962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3894  -13.4037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9887  -14.1135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4408  -14.0980    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   28.9740  -16.3640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9751  -17.1776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6825  -17.5874    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.3905  -17.1773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3910  -16.3575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6142  -12.6856    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3 12  2  0
 11  4  2  0
  4  1  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  1  5  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 15 16  2  0
 14 17  1  0
 17 18  1  0
  9 19  1  0
 19 20  1  0
 18 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 18  1  0
 22 26  1  0
 20 27  1  0
 20 31  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 23 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4569409

    ---

Associated Targets(Human)

MAPK1 Tchem MAP kinase ERK2 (25055 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 452.92Molecular Weight (Monoisotopic): 452.1415AlogP: 4.68#Rotatable Bonds: 5
Polar Surface Area: 67.35Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.89CX Basic pKa: 3.84CX LogP: 3.72CX LogD: 3.72
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.61Np Likeness Score: -1.33

References

1. Ji D, Zhang L, Zhu Q, Bai Y, Wu Y, Xu Y..  (2019)  Discovery of potent, orally bioavailable ERK1/2 inhibitors with isoindolin-1-one structure by structure-based drug design.,  164  [PMID:30605831] [10.1016/j.ejmech.2018.12.040]

Source