The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,6-Difluoro-3-((1-(4-bromophenyl)-4-ethyl-5-oxo-1,2,4-triazol-3-yl)methoxy)benzamide ID: ALA4569747
PubChem CID: 155552112
Max Phase: Preclinical
Molecular Formula: C18H15BrF2N4O3
Molecular Weight: 453.24
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCn1c(COc2ccc(F)c(C(N)=O)c2F)nn(-c2ccc(Br)cc2)c1=O
Standard InChI: InChI=1S/C18H15BrF2N4O3/c1-2-24-14(23-25(18(24)27)11-5-3-10(19)4-6-11)9-28-13-8-7-12(20)15(16(13)21)17(22)26/h3-8H,2,9H2,1H3,(H2,22,26)
Standard InChI Key: QTHGOGJRQAOZOV-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
18.6966 -14.6468 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.5138 -14.6468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7682 -13.8701 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.1052 -13.3880 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.4465 -13.8701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9061 -12.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9050 -13.4653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6130 -13.8743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3227 -13.4649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3199 -12.6422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6112 -12.2369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0260 -12.2309 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.1983 -12.2374 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.6088 -11.4197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3153 -11.0090 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.8999 -11.0133 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0310 -13.8723 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.7381 -13.4626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9934 -15.3085 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.4711 -13.4548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1818 -13.8587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8842 -13.4441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8764 -12.6268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1602 -12.2260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4608 -12.6429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5794 -12.2101 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
18.2154 -15.3073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4028 -15.2209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 2 0
5 1 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
10 12 1 0
6 13 1 0
11 14 1 0
14 15 1 0
14 16 2 0
9 17 1 0
17 18 1 0
18 5 1 0
2 19 2 0
3 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
23 26 1 0
1 27 1 0
27 28 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 453.24Molecular Weight (Monoisotopic): 452.0296AlogP: 2.77#Rotatable Bonds: 6Polar Surface Area: 92.14Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.96CX Basic pKa: ┄CX LogP: 3.32CX LogD: 3.32Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.62Np Likeness Score: -1.63
References 1. Bi F, Song D, Qin Y, Liu X, Teng Y, Zhang N, Zhang P, Zhang N, Ma S.. (2019) Discovery of 1,3,4-oxadiazol-2-one-containing benzamide derivatives targeting FtsZ as highly potent agents of killing a variety of MDR bacteria strains., 27 (14): [PMID:31200986 ] [10.1016/j.bmc.2019.06.010 ]