The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1-((2R,4R,5R)-3,3-Difluoro-4-hydroxy-5-(hydroxymethyl)-tetrahydrofuran-2-yl)-2-oxo-1,2-dihydropyrimidin-4-yl)-3-mercaptopropanamide ID: ALA4569800
PubChem CID: 155551879
Max Phase: Preclinical
Molecular Formula: C12H15F2N3O5S
Molecular Weight: 351.33
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCS)Nc1ccn([C@@H]2O[C@H](CO)[C@@H](O)C2(F)F)c(=O)n1
Standard InChI: InChI=1S/C12H15F2N3O5S/c13-12(14)9(20)6(5-18)22-10(12)17-3-1-7(16-11(17)21)15-8(19)2-4-23/h1,3,6,9-10,18,20,23H,2,4-5H2,(H,15,16,19,21)/t6-,9-,10-/m1/s1
Standard InChI Key: MODDLRRNEHNQAD-BDODKLCJSA-N
Molfile:
RDKit 2D
23 24 0 0 0 0 0 0 0 0999 V2000
3.0171 -8.8148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7248 -8.4032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4326 -8.8148 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4326 -9.6298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7248 -10.0414 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0171 -9.6298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7248 -10.8601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3857 -11.3408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1318 -12.1184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3178 -12.1184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0639 -11.3408 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9064 -12.8258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0877 -12.8258 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5433 -12.8258 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1791 -11.5533 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.9660 -10.7624 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.1441 -10.0412 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7248 -7.5845 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4323 -7.1772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4323 -6.3584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7248 -5.9511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7248 -5.1324 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.1438 -7.5845 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 2 0
4 3 1 0
5 4 1 0
6 5 1 0
1 6 2 0
7 5 1 1
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 7 1 0
10 12 1 1
12 13 1 0
9 14 1 6
8 15 1 0
8 16 1 0
4 17 2 0
2 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
19 23 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 351.33Molecular Weight (Monoisotopic): 351.0700AlogP: -0.61#Rotatable Bonds: 5Polar Surface Area: 113.68Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.08CX Basic pKa: ┄CX LogP: -0.86CX LogD: -0.86Aromatic Rings: 1Heavy Atoms: 23QED Weighted: 0.53Np Likeness Score: 0.19
References 1. Jiang Z, Pflug K, Usama SM, Kuai D, Yan X, Sitcheran R, Burgess K.. (2019) Cyanine-Gemcitabine Conjugates as Targeted Theranostic Agents for Glioblastoma Tumor Cells., 62 (20): [PMID:31469566 ] [10.1021/acs.jmedchem.9b01147 ]