4'-fluoro-6-(3-hydroxypropyl)biphenyl-3-carboxamide

ID: ALA4569810

PubChem CID: 122623278

Max Phase: Preclinical

Molecular Formula: C16H16FNO2

Molecular Weight: 273.31

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NC(=O)c1ccc(CCCO)c(-c2ccc(F)cc2)c1

Standard InChI:  InChI=1S/C16H16FNO2/c17-14-7-5-12(6-8-14)15-10-13(16(18)20)4-3-11(15)2-1-9-19/h3-8,10,19H,1-2,9H2,(H2,18,20)

Standard InChI Key:  QDVRUQCYYCVULV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 20 21  0  0  0  0  0  0  0  0999 V2000
    8.4759   -5.7657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4748   -6.5852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1828   -6.9942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8925   -6.5848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8896   -5.7621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1810   -5.3568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5958   -5.3508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3023   -5.7598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0080   -5.3492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0054   -4.5311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2911   -4.1254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5884   -4.5383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7110   -4.1189    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.1826   -7.8114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4748   -8.2198    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8902   -8.2202    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1786   -4.5397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8851   -4.1289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8826   -3.3118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5891   -2.9011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 10 13  1  0
  3 14  1  0
 14 15  2  0
 14 16  1  0
  6 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4569810

    ---

Associated Targets(Human)

CTNNB1 Tchem beta-catenin-B-cell lymphoma 9 protein complex (525 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 273.31Molecular Weight (Monoisotopic): 273.1165AlogP: 2.52#Rotatable Bonds: 5
Polar Surface Area: 63.32Molecular Species: NEUTRALHBA: 2HBD: 2
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.58CX LogD: 2.58
Aromatic Rings: 2Heavy Atoms: 20QED Weighted: 0.88Np Likeness Score: -0.34

References

1.  (2018)  Substituted n-([1,1''-biphenyl]-3-yl)-[1,1''-biphenyl]-3-carboxamide analogs as inhibitors for beta-catenin/b-cell lymphoma 9 interactions, 

Source