2-((2,4-dichlorophenyl)(hydroxy)methyl)-1,4-dihydroxyanthracene-9,10-dione

ID: ALA4569853

PubChem CID: 141750627

Max Phase: Preclinical

Molecular Formula: C21H12Cl2O5

Molecular Weight: 415.23

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1c2ccccc2C(=O)c2c(O)c(C(O)c3ccc(Cl)cc3Cl)cc(O)c21

Standard InChI:  InChI=1S/C21H12Cl2O5/c22-9-5-6-12(14(23)7-9)18(25)13-8-15(24)16-17(21(13)28)20(27)11-4-2-1-3-10(11)19(16)26/h1-8,18,24-25,28H

Standard InChI Key:  PWEUEAOVQWBFCM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
    4.8779   -5.4273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8779   -3.7929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1726   -5.0228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1752   -4.2075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4714   -3.7994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7647   -4.2055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7661   -5.0240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4704   -5.4284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5832   -4.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5816   -5.0210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2858   -5.4283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9921   -5.0214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9898   -4.2029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2850   -3.7993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8765   -2.9757    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8791   -6.2445    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2851   -6.2455    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2830   -2.9821    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6961   -3.7920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6935   -2.9748    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4016   -4.1974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4029   -5.0157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1111   -5.4219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8185   -5.0110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8132   -4.1896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1045   -3.7870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0996   -2.9699    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   10.5280   -5.4164    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  4  2  1  0
  3  1  1  0
  1 10  1  0
  9  2  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  2 15  2  0
  1 16  2  0
 11 17  1  0
 14 18  1  0
 13 19  1  0
 19 20  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 19 21  1  0
 26 27  1  0
 24 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4569853

    ---

Associated Targets(Human)

TOP2A Tclin DNA topoisomerase II (1334 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
L02 (4864 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HepG2 (196354 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 415.23Molecular Weight (Monoisotopic): 414.0062AlogP: 4.26#Rotatable Bonds: 2
Polar Surface Area: 94.83Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 8.49CX Basic pKa: CX LogP: 5.84CX LogD: 5.80
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.43Np Likeness Score: 0.46

References

1. Liu Y, Liang Y, Jiang J, Qin Q, Wang L, Liu X..  (2019)  Design, synthesis and biological evaluation of 1,4-dihydroxyanthraquinone derivatives as anticancer agents.,  29  (9): [PMID:30846253] [10.1016/j.bmcl.2019.02.026]

Source