Brachangobinan D

ID: ALA4569889

PubChem CID: 155551701

Max Phase: Preclinical

Molecular Formula: C30H38O9

Molecular Weight: 542.63

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(C(=O)[C@@H](COC(=O)CC(C)C)Oc2ccc(/C=C/COC(=O)CC(C)C)cc2OC)ccc1O

Standard InChI:  InChI=1S/C30H38O9/c1-19(2)14-28(32)37-13-7-8-21-9-12-24(26(16-21)36-6)39-27(18-38-29(33)15-20(3)4)30(34)22-10-11-23(31)25(17-22)35-5/h7-12,16-17,19-20,27,31H,13-15,18H2,1-6H3/b8-7+/t27-/m1/s1

Standard InChI Key:  RXBANWADADIHDZ-OVWDNRNUSA-N

Molfile:  

 
     RDKit          2D

 39 40  0  0  0  0  0  0  0  0999 V2000
   16.5075   -3.6691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5064   -4.4886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2144   -4.8976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9241   -4.4881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9212   -3.6655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2126   -3.2602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7997   -3.2606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2102   -2.4430    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.9167   -2.0323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6324   -4.8956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6337   -5.7128    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.3395   -4.4859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0478   -4.8934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.3382   -3.6687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0453   -3.2590    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.7549   -4.4837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4619   -4.8925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1685   -4.4835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1677   -3.6654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4544   -3.2581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7507   -3.6695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4621   -5.7097    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.7545   -6.1185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8742   -3.2548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5831   -3.6613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2896   -3.2507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9985   -3.6572    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.0440   -2.4418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7510   -2.0321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3356   -2.0343    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.7498   -1.2149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4568   -0.8052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0414   -0.8074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7050   -3.2466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4139   -3.6531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7027   -2.4294    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.1204   -3.2425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8293   -3.6490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1181   -2.4253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  6  8  1  0
  8  9  1  0
  4 10  1  0
 10 11  2  0
 10 12  1  0
 12 13  1  1
 12 14  1  0
 14 15  1  0
 13 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 17 22  1  0
 22 23  1  0
 19 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  1  0
 15 28  1  0
 28 29  1  0
 28 30  2  0
 29 31  1  0
 31 32  1  0
 31 33  1  0
 27 34  1  0
 34 35  1  0
 34 36  2  0
 35 37  1  0
 37 38  1  0
 37 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4569889

    ---

Associated Targets(non-human)

Trypanosoma congolense (178 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 542.63Molecular Weight (Monoisotopic): 542.2516AlogP: 5.23#Rotatable Bonds: 15
Polar Surface Area: 117.59Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 8.16CX Basic pKa: CX LogP: 5.54CX LogD: 5.47
Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.24Np Likeness Score: 0.41

References

1. Odonbayar B, Murata T, Suganuma K, Ishikawa Y, Buyankhishig B, Batkhuu J, Sasaki K..  (2019)  Acylated Lignans Isolated from Brachanthemum gobicum and Their Trypanocidal Activity.,  82  (4): [PMID:30896183] [10.1021/acs.jnatprod.8b00670]

Source