The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-5-(3-cyclopentyloxy-4-methoxybenzylidene)-3-(3-(4-(pirimidin-2-yl)piperazine-1-yl)propyl)-imidazolidine-2,4-dione ID: ALA4569899
PubChem CID: 155551704
Max Phase: Preclinical
Molecular Formula: C27H34N6O4
Molecular Weight: 506.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(/C=C2\NC(=O)N(CCCN3CCN(c4ncccn4)CC3)C2=O)cc1OC1CCCC1
Standard InChI: InChI=1S/C27H34N6O4/c1-36-23-9-8-20(19-24(23)37-21-6-2-3-7-21)18-22-25(34)33(27(35)30-22)13-5-12-31-14-16-32(17-15-31)26-28-10-4-11-29-26/h4,8-11,18-19,21H,2-3,5-7,12-17H2,1H3,(H,30,35)/b22-18-
Standard InChI Key: PWLAIAZTOQLLDA-PYCFMQQDSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
30.1562 -20.8466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1551 -21.6661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8631 -22.0751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5728 -21.6657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5700 -20.8430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8614 -20.4377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4471 -22.0742 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.7397 -21.6650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4484 -20.4382 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.4482 -19.6210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2761 -20.4317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9891 -20.8370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9885 -21.6548 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.7661 -21.9082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2474 -21.2469 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.7671 -20.5849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0202 -19.8079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.0180 -22.6856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.0646 -21.2475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4737 -20.5401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2909 -20.5407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7000 -19.8333 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.5160 -19.8366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9250 -19.1333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5204 -18.4229 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.7023 -18.4203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2887 -19.1282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9322 -17.7170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7475 -17.7224 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.1592 -17.0173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7538 -16.3068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9323 -16.3057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5243 -17.0113 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.1124 -19.1380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8597 -18.3609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0424 -18.3611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7902 -19.1384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
1 9 1 0
9 10 1 0
5 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 12 1 0
16 17 2 0
14 18 2 0
15 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
22 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
25 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
10 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 10 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 506.61Molecular Weight (Monoisotopic): 506.2642AlogP: 2.91#Rotatable Bonds: 9Polar Surface Area: 100.13Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.60CX Basic pKa: 7.20CX LogP: 2.51CX LogD: 2.30Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.41Np Likeness Score: -1.03
References 1. Czopek A, Bucki A, Kołaczkowski M, Zagórska A, Drop M, Pawłowski M, Siwek A, Głuch-Lutwin M, Pękala E, Chrzanowska A, Struga M, Partyka A, Wesołowska A.. (2019) Novel multitarget 5-arylidenehydantoins with arylpiperazinealkyl fragment: Pharmacological evaluation and investigation of cytotoxicity and metabolic stability., 27 (18): [PMID:31383628 ] [10.1016/j.bmc.2019.07.046 ]