The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4aS,7aS)-methyl 7-((4-(3-methylbenzyl)piperazin-1-yl)methyl)-2-isopropyl-1-oxo-2,4a,5,7a-tetrahydro-1H-cyclopenta[c]pyridine-4-carboxylate dihydrochloride ID: ALA4570019
PubChem CID: 155562373
Max Phase: Preclinical
Molecular Formula: C26H37Cl2N3O3
Molecular Weight: 437.58
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)C1=CN(C(C)C)C(=O)[C@@H]2C(CN3CCN(Cc4cccc(C)c4)CC3)=CC[C@H]12.Cl.Cl
Standard InChI: InChI=1S/C26H35N3O3.2ClH/c1-18(2)29-17-23(26(31)32-4)22-9-8-21(24(22)25(29)30)16-28-12-10-27(11-13-28)15-20-7-5-6-19(3)14-20;;/h5-8,14,17-18,22,24H,9-13,15-16H2,1-4H3;2*1H/t22-,24-;;/m1../s1
Standard InChI Key: PGXVLKAYSUFZHE-MACDPMPUSA-N
Molfile:
RDKit 2D
36 37 0 0 0 0 0 0 0 0999 V2000
37.8095 -29.9080 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
33.7396 -26.7733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0302 -28.0074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0302 -27.1861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2490 -26.9335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7686 -27.5987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2489 -28.2639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0261 -26.3647 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
33.0261 -28.8287 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
33.7396 -25.9520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4514 -25.5393 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.0277 -25.5393 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.1633 -25.9520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7300 -28.4159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7264 -29.2372 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.4434 -28.0058 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.4464 -27.1845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9964 -29.0411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1929 -29.2151 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.9403 -29.9964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6420 -28.6037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8385 -28.7736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5860 -29.5549 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.1369 -30.1663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7825 -29.7247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2316 -29.1174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4912 -28.3401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9411 -27.7290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1367 -27.8987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8853 -28.6848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4330 -29.2926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1499 -28.4164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1477 -29.2336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8588 -28.0097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1943 -26.9521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0142 -30.2464 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4 2 1 0
3 14 1 0
17 2 2 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 3 1 0
4 8 1 1
3 9 1 1
2 10 1 0
10 11 1 0
10 12 2 0
11 13 1 0
14 15 2 0
14 16 1 0
16 17 1 0
7 18 1 0
18 19 1 0
19 20 1 0
19 21 1 0
21 22 1 0
22 23 1 0
20 24 1 0
23 24 1 0
23 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
16 32 1 0
32 33 1 0
32 34 1 0
28 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 437.58Molecular Weight (Monoisotopic): 437.2678AlogP: 2.98#Rotatable Bonds: 6Polar Surface Area: 53.09Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.00CX LogP: 2.89CX LogD: 2.19Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.51Np Likeness Score: -0.32
References 1. Zhang Z, Wang Y, Zhang Y, Li J, Huang W, Wang L.. (2019) The synthesis and biological evaluation of novel gardenamide A derivatives as multifunctional neuroprotective agents., 10 (7): [PMID:31391892 ] [10.1039/C9MD00211A ]