6-(3,4-Dimethoxyphenyl)-N-(3-morpholinopropyl)-3-(1,3,4-oxadiazol-2-yl)quinolin-4-amine

ID: ALA4570067

PubChem CID: 153370142

Max Phase: Preclinical

Molecular Formula: C26H29N5O4

Molecular Weight: 475.55

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2ccc3ncc(-c4nnco4)c(NCCCN4CCOCC4)c3c2)cc1OC

Standard InChI:  InChI=1S/C26H29N5O4/c1-32-23-7-5-19(15-24(23)33-2)18-4-6-22-20(14-18)25(21(16-28-22)26-30-29-17-35-26)27-8-3-9-31-10-12-34-13-11-31/h4-7,14-17H,3,8-13H2,1-2H3,(H,27,28)

Standard InChI Key:  RSZMDVXYBFLGQU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   40.3051  -13.6735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3040  -14.4930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0120  -14.9020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0102  -13.2646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7188  -13.6699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7196  -14.4889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4281  -14.8959    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.1364  -14.4851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.1317  -13.6630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4225  -13.2596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8360  -13.2477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.5845  -13.5755    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   45.1276  -12.9649    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   44.7147  -12.2596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.9165  -12.4345    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.4182  -12.4425    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.7083  -12.0376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5994  -13.2652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6005  -12.4469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8935  -12.0386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1849  -12.4474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1878  -13.2688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8953  -13.6735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4766  -12.0399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.4753  -11.2227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7040  -11.2204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9941  -10.8156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9898   -9.9984    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.6963   -9.5907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6939   -8.7771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9858   -8.3684    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.2785   -8.7796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2792   -9.5994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4816  -13.6801    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.4847  -14.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 11  1  0
  9 11  1  0
 10 16  1  0
 16 17  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
  1 18  1  0
 21 24  1  0
 24 25  1  0
 17 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 28 33  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 22 34  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4570067

    ---

Associated Targets(Human)

TOP1 Tclin DNA topoisomerase I (7553 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 475.55Molecular Weight (Monoisotopic): 475.2220AlogP: 4.10#Rotatable Bonds: 9
Polar Surface Area: 94.77Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.39CX LogP: 1.80CX LogD: 1.41
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.36Np Likeness Score: -1.24

References

1. Kundu B, Das SK, Paul Chowdhuri S, Pal S, Sarkar D, Ghosh A, Mukherjee A, Bhattacharya D, Das BB, Talukdar A..  (2019)  Discovery and Mechanistic Study of Tailor-Made Quinoline Derivatives as Topoisomerase 1 Poison with Potent Anticancer Activity.,  62  (7): [PMID:30897325] [10.1021/acs.jmedchem.8b01938]

Source