The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-tert-butyl-8-[4-(dimethylamino)phenyl]-3-(2-morpholinoethyl)imidazo[2,1-f]purin-7-amine ID: ALA4570106
PubChem CID: 155564345
Max Phase: Preclinical
Molecular Formula: C25H34N8O
Molecular Weight: 462.60
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)c1ccc(-c2nc3c4ncn(CCN5CCOCC5)c4ncn3c2NC(C)(C)C)cc1
Standard InChI: InChI=1S/C25H34N8O/c1-25(2,3)29-24-20(18-6-8-19(9-7-18)30(4)5)28-23-21-22(27-17-33(23)24)32(16-26-21)11-10-31-12-14-34-15-13-31/h6-9,16-17,29H,10-15H2,1-5H3
Standard InChI Key: AVLMQZRLBCUKJR-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
32.8129 -8.2027 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.5260 -7.7921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2392 -8.2027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2392 -9.0281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5260 -9.4388 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.8129 -9.0281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0235 -9.2802 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.5085 -8.6135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0235 -7.9466 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.2370 -10.0775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0343 -10.2910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2478 -11.0884 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.0452 -11.3019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2588 -12.0992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6749 -12.6831 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.8776 -12.4696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6641 -11.6723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3558 -6.9842 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.5328 -6.8985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1988 -7.6510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4015 -7.8645 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.1879 -8.6618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3905 -8.8712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7717 -9.2416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9744 -9.4551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1224 -6.1814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2973 -6.1811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8854 -5.4706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3002 -4.7575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1194 -4.7553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5353 -5.4682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8855 -4.0404 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.0646 -4.0404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3002 -3.3275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
4 7 1 0
8 7 1 0
9 8 2 0
3 9 1 0
7 10 1 0
10 11 1 0
11 12 1 0
13 12 1 0
14 13 1 0
15 14 1 0
16 15 1 0
17 16 1 0
12 17 1 0
2 18 2 0
19 18 1 0
20 19 2 0
1 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
22 24 1 0
22 25 1 0
26 19 1 0
27 26 2 0
28 27 1 0
29 28 2 0
30 29 1 0
31 30 2 0
26 31 1 0
29 32 1 0
32 33 1 0
32 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 462.60Molecular Weight (Monoisotopic): 462.2856AlogP: 3.35#Rotatable Bonds: 6Polar Surface Area: 75.75Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.09CX LogP: 2.00CX LogD: 1.82Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.47Np Likeness Score: -1.54
References 1. Pelliccia S, Amato J, Capasso D, Di Gaetano S, Massarotti A, Piccolo M, Irace C, Tron GC, Pagano B, Randazzo A, Novellino E, Giustiniano M.. (2020) Bio-Inspired Dual-Selective BCL-2 /c-MYC G-Quadruplex Binders: Design, Synthesis, and Anticancer Activity of Drug-like Imidazo[2,1-i ]purine Derivatives., 63 (5): [PMID:31241946 ] [10.1021/acs.jmedchem.9b00262 ]