N-tert-butyl-8-[4-(dimethylamino)phenyl]-3-(2-morpholinoethyl)imidazo[2,1-f]purin-7-amine

ID: ALA4570106

PubChem CID: 155564345

Max Phase: Preclinical

Molecular Formula: C25H34N8O

Molecular Weight: 462.60

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C)c1ccc(-c2nc3c4ncn(CCN5CCOCC5)c4ncn3c2NC(C)(C)C)cc1

Standard InChI:  InChI=1S/C25H34N8O/c1-25(2,3)29-24-20(18-6-8-19(9-7-18)30(4)5)28-23-21-22(27-17-33(23)24)32(16-26-21)11-10-31-12-14-34-15-13-31/h6-9,16-17,29H,10-15H2,1-5H3

Standard InChI Key:  AVLMQZRLBCUKJR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   32.8129   -8.2027    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.5260   -7.7921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2392   -8.2027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2392   -9.0281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5260   -9.4388    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.8129   -9.0281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0235   -9.2802    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.5085   -8.6135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0235   -7.9466    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.2370  -10.0775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0343  -10.2910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2478  -11.0884    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.0452  -11.3019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2588  -12.0992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6749  -12.6831    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.8776  -12.4696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6641  -11.6723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3558   -6.9842    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.5328   -6.8985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1988   -7.6510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4015   -7.8645    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.1879   -8.6618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3905   -8.8712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7717   -9.2416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9744   -9.4551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1224   -6.1814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2973   -6.1811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8854   -5.4706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3002   -4.7575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1194   -4.7553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5353   -5.4682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8855   -4.0404    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.0646   -4.0404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3002   -3.3275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  4  7  1  0
  8  7  1  0
  9  8  2  0
  3  9  1  0
  7 10  1  0
 10 11  1  0
 11 12  1  0
 13 12  1  0
 14 13  1  0
 15 14  1  0
 16 15  1  0
 17 16  1  0
 12 17  1  0
  2 18  2  0
 19 18  1  0
 20 19  2  0
  1 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  0
 22 25  1  0
 26 19  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 26 31  1  0
 29 32  1  0
 32 33  1  0
 32 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4570106

    ---

Associated Targets(Human)

quadruplex DNA (2700 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 462.60Molecular Weight (Monoisotopic): 462.2856AlogP: 3.35#Rotatable Bonds: 6
Polar Surface Area: 75.75Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.09CX LogP: 2.00CX LogD: 1.82
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.47Np Likeness Score: -1.54

References

1. Pelliccia S, Amato J, Capasso D, Di Gaetano S, Massarotti A, Piccolo M, Irace C, Tron GC, Pagano B, Randazzo A, Novellino E, Giustiniano M..  (2020)  Bio-Inspired Dual-Selective BCL-2/c-MYC G-Quadruplex Binders: Design, Synthesis, and Anticancer Activity of Drug-like Imidazo[2,1-i]purine Derivatives.,  63  (5): [PMID:31241946] [10.1021/acs.jmedchem.9b00262]

Source