The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-((3-(4-chlorophenyl)-1-phenyl-1H-pyrazol-4-yl)((6-methoxybenzo[d]thiazol-2-yl)amino)methyl)naphthalen-2-ol ID: ALA4570163
PubChem CID: 155564310
Max Phase: Preclinical
Molecular Formula: C34H25ClN4O2S
Molecular Weight: 589.12
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2nc(NC(c3cn(-c4ccccc4)nc3-c3ccc(Cl)cc3)c3c(O)ccc4ccccc34)sc2c1
Standard InChI: InChI=1S/C34H25ClN4O2S/c1-41-25-16-17-28-30(19-25)42-34(36-28)37-33(31-26-10-6-5-7-21(26)13-18-29(31)40)27-20-39(24-8-3-2-4-9-24)38-32(27)22-11-14-23(35)15-12-22/h2-20,33,40H,1H3,(H,36,37)
Standard InChI Key: MCMZTARURFXRFN-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 48 0 0 0 0 0 0 0 0999 V2000
4.8085 -6.2270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8074 -7.0548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5224 -7.4677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5206 -5.8142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2362 -6.2234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2370 -7.0506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9526 -7.4616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6679 -7.0468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6631 -6.2165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9470 -5.8091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3753 -5.7996 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9426 -4.9839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6550 -4.5675 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2257 -4.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1325 -3.7581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3244 -3.5908 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9155 -4.3077 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4710 -4.9180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7404 -3.2047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5277 -3.4559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1368 -2.9001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9597 -2.0931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1682 -1.8449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5624 -2.4024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0988 -4.3972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6105 -3.7305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7910 -3.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4586 -4.5771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9519 -5.2440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7698 -5.1504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4779 -4.5640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9679 -5.2250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9625 -3.8938 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.7460 -4.1446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7465 -4.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4575 -5.3752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1684 -4.9631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1638 -4.1381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4523 -3.7331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8761 -3.7212 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5933 -4.1297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5683 -1.5358 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
9 11 1 0
10 12 1 0
12 13 1 0
12 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 1 0
18 14 2 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
15 19 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
17 25 1 0
13 31 1 0
31 32 2 0
32 35 1 0
34 33 1 0
33 31 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
38 40 1 0
40 41 1 0
22 42 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 589.12Molecular Weight (Monoisotopic): 588.1387AlogP: 8.87#Rotatable Bonds: 7Polar Surface Area: 72.20Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.92CX Basic pKa: 3.54CX LogP: 9.03CX LogD: 9.02Aromatic Rings: 7Heavy Atoms: 42QED Weighted: 0.19Np Likeness Score: -1.41
References 1. Nagaraju B, Kovvuri J, Kumar CG, Routhu SR, Shareef MA, Kadagathur M, Adiyala PR, Alavala S, Nagesh N, Kamal A.. (2019) Synthesis and biological evaluation of pyrazole linked benzothiazole-β-naphthol derivatives as topoisomerase I inhibitors with DNA binding ability., 27 (5): [PMID:30679134 ] [10.1016/j.bmc.2019.01.011 ]