N-(5-Chloro-2-propoxybenzyl)-N-(4-(N-(prop-2-yn-1-yl)sulfamoyl)phenethyl)-1,2,5-thiadiazole-3-carboxamide

ID: ALA4570220

PubChem CID: 155562675

Max Phase: Preclinical

Molecular Formula: C24H25ClN4O4S2

Molecular Weight: 533.08

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C#CCNS(=O)(=O)c1ccc(CCN(Cc2cc(Cl)ccc2OCCC)C(=O)c2cnsn2)cc1

Standard InChI:  InChI=1S/C24H25ClN4O4S2/c1-3-12-27-35(31,32)21-8-5-18(6-9-21)11-13-29(24(30)22-16-26-34-28-22)17-19-15-20(25)7-10-23(19)33-14-4-2/h1,5-10,15-16,27H,4,11-14,17H2,2H3

Standard InChI Key:  QIXGWAGREYCNSE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 37  0  0  0  0  0  0  0  0999 V2000
   23.8595   -5.2581    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.4550   -4.5482    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   23.0419   -5.2555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.7448   -3.3283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0353   -2.9151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3263   -3.3255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3256   -4.1449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0398   -4.5521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7459   -4.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6148   -2.9123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9026   -3.3244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1952   -2.9112    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.4831   -3.3234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7715   -2.9101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7757   -2.0890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0650   -1.6799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3519   -2.0881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3539   -2.9136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0651   -3.3231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0679   -4.1444    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.1696   -4.1400    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.1712   -3.3186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8838   -2.9073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5888   -2.4928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0660   -0.8628    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   17.7769   -4.5506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7797   -5.3678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4888   -5.7740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1969   -2.0940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9054   -1.6868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4900   -1.6840    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.6486   -2.0160    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.1967   -1.4098    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   20.7895   -0.7012    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.9898   -0.8696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  6 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 19 20  1  0
  9  2  1  0
  2 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  3  0
 16 25  1  0
 20 26  1  0
 26 27  1  0
 27 28  1  0
 12 29  1  0
 29 30  1  0
 29 31  2  0
 30 32  2  0
 32 33  1  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4570220

    ---

Associated Targets(non-human)

Nlrp3 NACHT, LRR and PYD domains-containing protein 3 (641 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 533.08Molecular Weight (Monoisotopic): 532.1006AlogP: 3.78#Rotatable Bonds: 12
Polar Surface Area: 101.49Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.13CX Basic pKa: CX LogP: 4.16CX LogD: 4.16
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.36Np Likeness Score: -1.97

References

1. Jiang Y, He L, Green J, Blevins H, Guo C, Patel SH, Halquist MS, McRae M, Venitz J, Wang XY, Zhang S..  (2019)  Discovery of Second-Generation NLRP3 Inflammasome Inhibitors: Design, Synthesis, and Biological Characterization.,  62  (21): [PMID:31626545] [10.1021/acs.jmedchem.9b01155]

Source