The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Ethoxycarbonylmethyl{2-[5-(10-methyl-10H-phenothiazin-3-ylmethylene)-4-oxo-2-thioxothiazolidin-3-yl]acetyl}amino)acetic acid ethyl ester ID: ALA4570231
PubChem CID: 155562776
Max Phase: Preclinical
Molecular Formula: C27H27N3O6S3
Molecular Weight: 585.73
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)CN(CC(=O)OCC)C(=O)CN1C(=O)/C(=C\c2ccc3c(c2)Sc2ccccc2N3C)SC1=S
Standard InChI: InChI=1S/C27H27N3O6S3/c1-4-35-24(32)15-29(16-25(33)36-5-2)23(31)14-30-26(34)22(39-27(30)37)13-17-10-11-19-21(12-17)38-20-9-7-6-8-18(20)28(19)3/h6-13H,4-5,14-16H2,1-3H3/b22-13+
Standard InChI Key: ROIRNZGUYPHTLL-LPYMAVHISA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
3.2715 -13.5662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2703 -14.3857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9784 -14.7947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9766 -13.1573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6852 -13.5626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6840 -14.3878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3941 -14.7991 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3965 -13.1487 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.1111 -13.5646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1099 -14.3857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8192 -14.7955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5302 -14.3854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5275 -13.5612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8176 -13.1551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3936 -15.6163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2338 -13.1501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9429 -13.5561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0289 -14.3650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8288 -14.5320 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2349 -13.8228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6858 -13.2176 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.4229 -14.9133 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0473 -13.7344 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.1639 -15.2774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9769 -15.3599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3120 -16.1052 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4549 -14.6970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1250 -16.1877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4601 -16.9330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2731 -17.0155 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9822 -17.5959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6082 -17.7608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8341 -16.7680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0210 -16.6856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5431 -17.3484 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6860 -15.9402 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7301 -17.2659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4212 -17.8433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2521 -17.9288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 8 1 0
6 7 1 0
7 10 1 0
9 8 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
7 15 1 0
13 16 1 0
16 17 2 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 17 1 0
18 22 2 0
20 23 2 0
19 24 1 0
24 25 1 0
25 26 1 0
25 27 2 0
26 28 1 0
28 29 1 0
29 30 1 0
29 31 2 0
30 32 1 0
26 33 1 0
33 34 1 0
34 35 1 0
34 36 2 0
35 37 1 0
32 38 1 0
37 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 585.73Molecular Weight (Monoisotopic): 585.1062AlogP: 4.08#Rotatable Bonds: 9Polar Surface Area: 96.46Molecular Species: NEUTRALHBA: 10HBD: ┄#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.92CX LogD: 3.92Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.24Np Likeness Score: -1.49
References 1. Li Y, Yan L, Cai J, Zhang W, Li L, Du Z, Dong C, Meunier B, Chen H.. (2019) Development of novel theranostic agents for in vivo amyloid imaging and protective effects on human neuroblastoma cells., 181 [PMID:31404860 ] [10.1016/j.ejmech.2019.111585 ]