(Ethoxycarbonylmethyl{2-[5-(10-methyl-10H-phenothiazin-3-ylmethylene)-4-oxo-2-thioxothiazolidin-3-yl]acetyl}amino)acetic acid ethyl ester

ID: ALA4570231

PubChem CID: 155562776

Max Phase: Preclinical

Molecular Formula: C27H27N3O6S3

Molecular Weight: 585.73

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)CN(CC(=O)OCC)C(=O)CN1C(=O)/C(=C\c2ccc3c(c2)Sc2ccccc2N3C)SC1=S

Standard InChI:  InChI=1S/C27H27N3O6S3/c1-4-35-24(32)15-29(16-25(33)36-5-2)23(31)14-30-26(34)22(39-27(30)37)13-17-10-11-19-21(12-17)38-20-9-7-6-8-18(20)28(19)3/h6-13H,4-5,14-16H2,1-3H3/b22-13+

Standard InChI Key:  ROIRNZGUYPHTLL-LPYMAVHISA-N

Molfile:  

 
     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
    3.2715  -13.5662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2703  -14.3857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9784  -14.7947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9766  -13.1573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6852  -13.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6840  -14.3878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3941  -14.7991    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3965  -13.1487    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.1111  -13.5646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1099  -14.3857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8192  -14.7955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5302  -14.3854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5275  -13.5612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8176  -13.1551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3936  -15.6163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2338  -13.1501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9429  -13.5561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0289  -14.3650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8288  -14.5320    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2349  -13.8228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6858  -13.2176    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.4229  -14.9133    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0473  -13.7344    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.1639  -15.2774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9769  -15.3599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3120  -16.1052    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.4549  -14.6970    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1250  -16.1877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4601  -16.9330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2731  -17.0155    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9822  -17.5959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6082  -17.7608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8341  -16.7680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0210  -16.6856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5431  -17.3484    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6860  -15.9402    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7301  -17.2659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4212  -17.8433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2521  -17.9288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5  8  1  0
  6  7  1  0
  7 10  1  0
  9  8  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  7 15  1  0
 13 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 17  1  0
 18 22  2  0
 20 23  2  0
 19 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  2  0
 26 28  1  0
 28 29  1  0
 29 30  1  0
 29 31  2  0
 30 32  1  0
 26 33  1  0
 33 34  1  0
 34 35  1  0
 34 36  2  0
 35 37  1  0
 32 38  1  0
 37 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4570231

    ---

Associated Targets(Human)

APP Tclin Amyloid-beta A4 protein (8510 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SH-SY5Y (11521 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 585.73Molecular Weight (Monoisotopic): 585.1062AlogP: 4.08#Rotatable Bonds: 9
Polar Surface Area: 96.46Molecular Species: NEUTRALHBA: 10HBD:
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 3.92CX LogD: 3.92
Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.24Np Likeness Score: -1.49

References

1. Li Y, Yan L, Cai J, Zhang W, Li L, Du Z, Dong C, Meunier B, Chen H..  (2019)  Development of novel theranostic agents for in vivo amyloid imaging and protective effects on human neuroblastoma cells.,  181  [PMID:31404860] [10.1016/j.ejmech.2019.111585]

Source