N-(5-(2,3-dimethylphenyl)-1,2,3,4-tetrahydro-1,6-naphthyridin-7-yl)cyclopropanecarboxamide

ID: ALA4570266

PubChem CID: 155562444

Max Phase: Preclinical

Molecular Formula: C20H23N3O

Molecular Weight: 321.42

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cccc(-c2nc(NC(=O)C3CC3)cc3c2CCCN3)c1C

Standard InChI:  InChI=1S/C20H23N3O/c1-12-5-3-6-15(13(12)2)19-16-7-4-10-21-17(16)11-18(22-19)23-20(24)14-8-9-14/h3,5-6,11,14,21H,4,7-10H2,1-2H3,(H,22,23,24)

Standard InChI Key:  ZFBYGTWJSGKGRT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 24 27  0  0  0  0  0  0  0  0999 V2000
   20.3830   -2.7900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3818   -3.6095    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.0899   -4.0185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0881   -2.3811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7958   -2.7904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7955   -3.6116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5026   -4.0201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2145   -3.6121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2148   -2.7909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5032   -2.3778    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.0915   -4.8336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3820   -5.2413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3814   -6.0577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0895   -6.4674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7997   -6.0547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7968   -5.2396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6752   -2.3815    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.9675   -2.7903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9677   -3.6075    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.6749   -4.8317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6733   -6.4657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2597   -2.3819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8549   -1.6731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4465   -2.3809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  3 11  1  0
  1 17  1  0
 17 18  1  0
 18 19  2  0
 12 20  1  0
 13 21  1  0
 18 22  1  0
 23 22  1  0
 24 23  1  0
 22 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4570266

    ---

Associated Targets(Human)

NUDT1 Tchem 7,8-dihydro-8-oxoguanine triphosphatase (280 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 321.42Molecular Weight (Monoisotopic): 321.1841AlogP: 4.07#Rotatable Bonds: 3
Polar Surface Area: 54.02Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.09CX Basic pKa: 7.34CX LogP: 4.38CX LogD: 4.12
Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.90Np Likeness Score: -0.98

References

1. Farand J, Kropf JE, Blomgren P, Xu J, Schmitt AC, Newby ZE, Wang T, Murakami E, Barauskas O, Sudhamsu J, Feng JY, Niedziela-Majka A, Schultz BE, Schwartz K, Viatchenko-Karpinski S, Kornyeyev D, Kashishian A, Fan P, Chen X, Lansdon EB, Ports MO, Currie KS, Watkins WJ, Notte GT..  (2020)  Discovery of Potent and Selective MTH1 Inhibitors for Oncology: Enabling Rapid Target (In)Validation.,  11  (3): [PMID:32184970] [10.1021/acsmedchemlett.9b00420]

Source