The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Acetic acid 2-(2-{[2-ethyl-6-(4-nitrophenyl)imidazo[2,1-b][1,3,4]thiadiazol-5-ylmethylene]hydrazono}-4-oxothiazolidin-5-yl)ethyl ester ID: ALA4570275
PubChem CID: 155562485
Max Phase: Preclinical
Molecular Formula: C20H19N7O5S2
Molecular Weight: 501.55
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCc1nn2c(/C=N/N=C3/NC(=O)C(CCOC(C)=O)S3)c(-c3ccc([N+](=O)[O-])cc3)nc2s1
Standard InChI: InChI=1S/C20H19N7O5S2/c1-3-16-25-26-14(10-21-24-19-23-18(29)15(33-19)8-9-32-11(2)28)17(22-20(26)34-16)12-4-6-13(7-5-12)27(30)31/h4-7,10,15H,3,8-9H2,1-2H3,(H,23,24,29)/b21-10+
Standard InChI Key: LYMMCDZASHLTEN-UFFVCSGVSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
43.7225 -24.2622 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.7042 -22.9220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2326 -23.5989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.4963 -23.1667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.5054 -23.9934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.2947 -24.2431 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
45.7750 -23.5680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.2798 -22.9039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.4107 -23.6114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9860 -22.8991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1602 -22.9102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7581 -23.6330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1837 -24.3459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0081 -24.3313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4383 -22.1395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6271 -21.9806 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.3613 -21.1981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.5501 -21.0392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1977 -20.2922 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.3769 -20.3905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2180 -21.2017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9407 -21.6021 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
39.8175 -19.7835 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.4724 -21.5488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7990 -21.0766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9331 -23.6483 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.5327 -24.3667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.5111 -22.9423 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.0533 -21.4237 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.3798 -20.9515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6342 -21.2986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4521 -20.1322 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
46.5974 -23.5589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.0166 -24.2665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 5 2 0
4 2 1 0
2 3 2 0
3 1 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 4 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
3 9 1 0
2 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 18 1 0
20 23 2 0
21 24 1 0
24 25 1 0
26 27 2 0
26 28 1 0
12 26 1 0
25 29 1 0
29 30 1 0
30 31 1 0
30 32 2 0
7 33 1 0
33 34 1 0
M CHG 2 26 1 28 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 501.55Molecular Weight (Monoisotopic): 501.0889AlogP: 2.80#Rotatable Bonds: 8Polar Surface Area: 153.45Molecular Species: NEUTRALHBA: 12HBD: 1#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.34CX Basic pKa: 1.95CX LogP: 3.03CX LogD: 2.69Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.21Np Likeness Score: -1.54
References 1. Kryshchyshyn A, Kaminskyy D, Karpenko O, Gzella A, Grellier P, Lesyk R.. (2019) Thiazolidinone/thiazole based hybrids - New class of antitrypanosomal agents., 174 [PMID:31051403 ] [10.1016/j.ejmech.2019.04.052 ]