2-(3-fluoro-4-(7-(2-(2-(2-methoxyethoxy)ethoxy)phenyl)thieno[2,3-d]pyridazin-4-ylamino)phenyl)acetamide

ID: ALA4570366

PubChem CID: 155562849

Max Phase: Preclinical

Molecular Formula: C25H25FN4O4S

Molecular Weight: 496.56

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COCCOCCOc1ccccc1-c1nnc(Nc2ccc(CC(N)=O)cc2F)c2ccsc12

Standard InChI:  InChI=1S/C25H25FN4O4S/c1-32-9-10-33-11-12-34-21-5-3-2-4-17(21)23-24-18(8-13-35-24)25(30-29-23)28-20-7-6-16(14-19(20)26)15-22(27)31/h2-8,13-14H,9-12,15H2,1H3,(H2,27,31)(H,28,30)

Standard InChI Key:  VFWQGMJXTDLSNC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   41.8047  -19.4888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9814  -17.0399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6911  -16.6304    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.6882  -15.8078    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.9796  -15.4025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2734  -16.6309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2746  -15.8144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4984  -15.5609    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   37.0174  -16.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4964  -16.8820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9744  -14.5906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6819  -14.1793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6785  -13.3629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9684  -12.9568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2602  -13.3730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2671  -14.1881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9812  -17.8571    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.6888  -18.2658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6845  -19.0812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3913  -19.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1000  -19.0815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0976  -18.2600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3903  -17.8550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5155  -19.0799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2236  -19.4878    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.5146  -18.2627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.9756  -19.4877    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   40.3911  -14.5854    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.0973  -14.1743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8065  -14.5803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5127  -14.1692    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.2219  -14.5753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.9281  -14.1642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.6373  -14.5702    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   45.3435  -14.1591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  6  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  7  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10  6  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  5 11  1  0
  2 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21  1  1  0
  1 24  1  0
 24 25  1  0
 24 26  2  0
 19 27  1  0
 12 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4570366

    ---

Associated Targets(non-human)

Slc2a4 Solute carrier family 2, facilitated glucose transporter member 4 (143 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 496.56Molecular Weight (Monoisotopic): 496.1581AlogP: 4.31#Rotatable Bonds: 12
Polar Surface Area: 108.59Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.93CX Basic pKa: 0.83CX LogP: 3.44CX LogD: 3.44
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.28Np Likeness Score: -1.65

References

1. Tsuji T, Yamaguchi M, Kuroyanagi J, Furuzono S, Konishi M, Terayama K, Tanaka J, Saito M, Kobayashi Y..  (2019)  Discovery of novel pyridazine derivatives as glucose transporter type 4 (GLUT4) translocation activators.,  29  (14): [PMID:31101471] [10.1016/j.bmcl.2019.05.013]

Source