2-(3-(3-fluorobenzamido)phenyl)-4-((4-(4-methylpiperazin-1-yl)phenyl)amino)thiazole-5-carboxamide

ID: ALA4570521

PubChem CID: 155562686

Max Phase: Preclinical

Molecular Formula: C28H27FN6O2S

Molecular Weight: 530.63

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN1CCN(c2ccc(Nc3nc(-c4cccc(NC(=O)c5cccc(F)c5)c4)sc3C(N)=O)cc2)CC1

Standard InChI:  InChI=1S/C28H27FN6O2S/c1-34-12-14-35(15-13-34)23-10-8-21(9-11-23)31-26-24(25(30)36)38-28(33-26)19-5-3-7-22(17-19)32-27(37)18-4-2-6-20(29)16-18/h2-11,16-17,31H,12-15H2,1H3,(H2,30,36)(H,32,37)

Standard InChI Key:  ZQZSPOVIAINDAN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   34.2568   -5.5588    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.0819   -5.5588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3387   -4.7746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6693   -4.2878    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   34.0043   -4.7746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5661   -6.2268    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.3867   -6.1416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8667   -6.8096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6866   -6.7247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0238   -5.9707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5351   -5.3008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7169   -5.3890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8406   -5.8864    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.3246   -6.5557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1418   -6.4717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4813   -5.7193    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.9973   -5.0499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1737   -5.1330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3021   -5.6360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2217   -4.5227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0509   -3.7142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2669   -3.4596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6530   -4.0122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8284   -4.8227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6122   -5.0737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0954   -2.6525    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.3107   -2.3976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1392   -1.5905    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.6975   -2.9496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9159   -2.6934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3030   -3.2447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4742   -4.0527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2639   -4.3064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8733   -3.7534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1271   -4.5188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7395   -5.0717    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.2998   -3.7120    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.5185   -2.9893    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  1  2  0
  2  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 13 14  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 10 13  1  0
 16 19  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
  5 20  1  0
 22 26  1  0
 26 27  1  0
 27 28  2  0
 27 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 35 36  2  0
 35 37  1  0
  3 35  1  0
 31 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4570521

    ---

Associated Targets(Human)

Raji (5516 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Ramos (1218 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BTK Tclin Tyrosine-protein kinase BTK (8973 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 530.63Molecular Weight (Monoisotopic): 530.1900AlogP: 4.80#Rotatable Bonds: 7
Polar Surface Area: 103.59Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.78CX Basic pKa: 7.97CX LogP: 6.16CX LogD: 5.49
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.32Np Likeness Score: -1.99

References

1. Guo X, Yang D, Fan Z, Zhang N, Zhao B, Huang C, Wang F, Ma R, Meng M, Deng Y..  (2019)  Discovery and structure-activity relationship of novel diphenylthiazole derivatives as BTK inhibitor with potent activity against B cell lymphoma cell lines.,  178  [PMID:31234030] [10.1016/j.ejmech.2019.06.035]

Source