The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
rac-Ethyl 1-(1-(2-chloroacetyl)piperidin-3-yl)-3-(4-phenoxyphenyl)-1H-pyrazole-5-carboxylate ID: ALA4570642
PubChem CID: 155562780
Max Phase: Preclinical
Molecular Formula: C25H26ClN3O4
Molecular Weight: 467.95
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1cc(-c2ccc(Oc3ccccc3)cc2)nn1C1CCCN(C(=O)CCl)C1
Standard InChI: InChI=1S/C25H26ClN3O4/c1-2-32-25(31)23-15-22(27-29(23)19-7-6-14-28(17-19)24(30)16-26)18-10-12-21(13-11-18)33-20-8-4-3-5-9-20/h3-5,8-13,15,19H,2,6-7,14,16-17H2,1H3
Standard InChI Key: GLGXTLLJCXESGD-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
31.4911 -14.7650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1644 -15.2417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.8271 -14.7501 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.5622 -13.9661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7382 -13.9790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1705 -16.0675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4587 -16.4866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4658 -17.3080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1830 -17.7165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8948 -17.2974 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.8893 -16.4697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0378 -13.2930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8604 -13.3694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3359 -12.6961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9902 -11.9462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1640 -11.8734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6921 -12.5476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4650 -11.2715 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.2867 -11.3454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6296 -12.0977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4506 -12.1719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9263 -11.4968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5752 -10.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7553 -10.6749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6124 -17.7044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6186 -18.5294 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.3237 -17.2865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0413 -17.6935 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
30.7093 -15.0284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0902 -14.4831 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.5466 -15.8372 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.3084 -14.7466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6893 -14.2012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 2 0
6 7 1 0
6 11 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
6 2 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
4 12 1 0
15 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
10 25 1 0
25 26 2 0
25 27 1 0
27 28 1 0
1 29 1 0
29 30 1 0
29 31 2 0
30 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 467.95Molecular Weight (Monoisotopic): 467.1612AlogP: 4.92#Rotatable Bonds: 7Polar Surface Area: 73.66Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 1.08CX LogP: 4.46CX LogD: 4.46Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.36Np Likeness Score: -1.25
References 1. Ran F, Liu Y, Zhang D, Liu M, Zhao G.. (2019) Discovery of novel pyrazole derivatives as potential anticancer agents in MCL., 29 (9): [PMID:30857748 ] [10.1016/j.bmcl.2019.03.005 ]