3-benzyl-6-(2-bromobenzyl)-1-ethyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine-2,4(1H,3H)-dione

ID: ALA4570676

PubChem CID: 155562958

Max Phase: Preclinical

Molecular Formula: C23H24BrN3O2

Molecular Weight: 454.37

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCn1c2c(c(=O)n(Cc3ccccc3)c1=O)CN(Cc1ccccc1Br)CC2

Standard InChI:  InChI=1S/C23H24BrN3O2/c1-2-26-21-12-13-25(15-18-10-6-7-11-20(18)24)16-19(21)22(28)27(23(26)29)14-17-8-4-3-5-9-17/h3-11H,2,12-16H2,1H3

Standard InChI Key:  ZXADMUZEKZIQJX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   29.6954  -20.4752    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.6954  -21.2924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4007  -21.6968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4007  -20.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1060  -20.4752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1025  -21.2924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5181  -20.4812    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.8115  -20.0673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5146  -21.2984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8051  -21.7022    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.8138  -19.2501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.2279  -20.0763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9865  -20.0687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2202  -21.7106    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.8007  -22.5194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0909  -22.9242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9335  -20.4886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9270  -21.3058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6317  -21.7180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3426  -21.3131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3443  -20.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6389  -20.0832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2800  -20.4793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5717  -20.0697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8656  -20.4797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8676  -21.2977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5815  -21.7041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2846  -21.2918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5709  -19.2525    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  5  6  2  0
  5  8  1  0
  6 10  1  0
  9  7  1  0
  7  8  1  0
  9 10  1  0
  8 11  2  0
  7 12  1  0
  1 13  1  0
  9 14  2  0
 10 15  1  0
 15 16  1  0
 12 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 13 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 24 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4570676

    ---

Associated Targets(Human)

NCI-H3122 (436 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MV4-11 (7307 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 454.37Molecular Weight (Monoisotopic): 453.1052AlogP: 3.40#Rotatable Bonds: 5
Polar Surface Area: 47.24Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.08CX LogP: 3.72CX LogD: 3.55
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.59Np Likeness Score: -1.28

References

1. Ma Z, Gao G, Fang K, Sun H..  (2019)  Development of Novel Anticancer Agents with a Scaffold of Tetrahydropyrido[4,3-d]pyrimidine-2,4-dione.,  10  (2): [PMID:30783502] [10.1021/acsmedchemlett.8b00531]

Source