The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-((4-(3-(hydroxyamino)-3-oxoprop-1-en-1-yl)benzyl)oxy)-3,4,5-trimethoxybenzamide ID: ALA4570738
PubChem CID: 155561445
Max Phase: Preclinical
Molecular Formula: C20H22N2O7
Molecular Weight: 402.40
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C(=O)NOCc2ccc(/C=C/C(=O)NO)cc2)cc(OC)c1OC
Standard InChI: InChI=1S/C20H22N2O7/c1-26-16-10-15(11-17(27-2)19(16)28-3)20(24)22-29-12-14-6-4-13(5-7-14)8-9-18(23)21-25/h4-11,25H,12H2,1-3H3,(H,21,23)(H,22,24)/b9-8+
Standard InChI Key: YZYKDCAQJIOPOU-CMDGGOBGSA-N
Molfile:
RDKit 2D
29 30 0 0 0 0 0 0 0 0999 V2000
9.4830 -20.1780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4818 -20.9975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1899 -21.4065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8995 -20.9970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8967 -20.1744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1881 -19.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7738 -21.4056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0664 -20.9964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6028 -19.7631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3121 -20.1691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0183 -19.7578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7275 -20.1637 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.0152 -18.9406 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4337 -19.7525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3584 -21.4044 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6510 -20.9953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9429 -21.4033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6516 -20.1781 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2390 -20.9933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5315 -21.4006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5304 -22.2187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2427 -22.6277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9474 -22.2180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8229 -22.6277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1150 -22.2195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8243 -20.9911 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8253 -20.1740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2450 -23.4449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5384 -23.8554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
5 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
11 13 2 0
12 14 1 0
8 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
17 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 17 1 0
21 24 1 0
24 25 1 0
20 26 1 0
26 27 1 0
22 28 1 0
28 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 402.40Molecular Weight (Monoisotopic): 402.1427AlogP: 2.09#Rotatable Bonds: 9Polar Surface Area: 115.35Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.55CX Basic pKa: ┄CX LogP: 1.80CX LogD: 1.80Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.33Np Likeness Score: -0.25
References 1. Pflieger M, Hamacher A, Öz T, Horstick-Muche N, Boesen B, Schrenk C, Kassack MU, Kurz T.. (2019) Novel α,β-unsaturated hydroxamic acid derivatives overcome cisplatin resistance., 27 (19): [PMID:31431326 ] [10.1016/j.bmc.2019.07.052 ]