(4Z,7Z,10Z,13Z,16Z,19Z)-N-(Trifluoromethylsulfonyl)docosa-4,7,10,13,16,19-hexaenamide

ID: ALA4570753

PubChem CID: 155561474

Max Phase: Preclinical

Molecular Formula: C23H32F3NO3S

Molecular Weight: 459.57

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NS(=O)(=O)C(F)(F)F

Standard InChI:  InChI=1S/C23H32F3NO3S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(28)27-31(29,30)23(24,25)26/h3-4,6-7,9-10,12-13,15-16,18-19H,2,5,8,11,14,17,20-21H2,1H3,(H,27,28)/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18-

Standard InChI Key:  GGSCINOZXZCINC-KUBAVDMBSA-N

Molfile:  

 
     RDKit          2D

 31 30  0  0  0  0  0  0  0  0999 V2000
   15.2873  -23.2404    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8828  -22.5347    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   14.4738  -23.2378    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.3067  -22.5429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0185  -22.1302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7262  -22.5429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4381  -22.1302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5948  -22.1302    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.3067  -23.3642    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.1465  -22.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1480  -23.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8565  -23.7620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8580  -24.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1510  -24.9891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1525  -25.8063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4456  -26.2161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7371  -25.8089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0301  -26.2187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3217  -25.8115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3202  -24.9943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6117  -24.5870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9048  -24.9969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9063  -25.8140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1993  -26.2239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1977  -27.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9045  -27.4475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6131  -27.0403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1794  -22.1276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1803  -21.3104    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.4713  -22.5355    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.4671  -21.7175    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  4  8  1  0
  4  9  2  0
  7 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  1  0
  8  2  1  0
  2 28  1  0
 28 29  1  0
 28 30  1  0
 28 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4570753

    ---

Associated Targets(non-human)

RBL-2H3 (1162 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 459.57Molecular Weight (Monoisotopic): 459.2055AlogP: 6.43#Rotatable Bonds: 15
Polar Surface Area: 63.24Molecular Species: ACIDHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.06CX Basic pKa: CX LogP: 7.54CX LogD: 6.59
Aromatic Rings: Heavy Atoms: 31QED Weighted: 0.29Np Likeness Score: 0.35

References

1. Kim IH, Kanayama Y, Nishiwaki H, Sugahara T, Nishi K..  (2019)  Structure-Activity Relationships of Fish Oil Derivatives with Antiallergic Activity in Vitro and in Vivo.,  62  (21): [PMID:31618024] [10.1021/acs.jmedchem.9b00994]

Source