The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-Cyclopropylmethyl-7alpha-4'-cyclopropylmethylaminophenyl-6,14-endoethanotetrahydronorthebaine ID: ALA4570786
PubChem CID: 155561575
Max Phase: Preclinical
Molecular Formula: C34H42N2O3
Molecular Weight: 526.72
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2c3c1O[C@H]1[C@@]4(OC)CC[C@@]5(C[C@@H]4c4ccc(NCC6CC6)cc4)[C@@H](C2)N(CC2CC2)CC[C@]315
Standard InChI: InChI=1S/C34H42N2O3/c1-37-27-12-9-24-17-28-32-13-14-34(38-2,26(18-32)23-7-10-25(11-8-23)35-19-21-3-4-21)31-33(32,29(24)30(27)39-31)15-16-36(28)20-22-5-6-22/h7-12,21-22,26,28,31,35H,3-6,13-20H2,1-2H3/t26-,28-,31-,32-,33+,34-/m1/s1
Standard InChI Key: IIAZRIURVNMAHF-DPODCYPTSA-N
Molfile:
RDKit 2D
41 49 0 0 0 0 0 0 0 0999 V2000
30.8263 -14.8415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0132 -14.8415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2390 -14.1358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6170 -15.5349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2266 -15.5349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3847 -16.0178 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.8056 -13.4300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6170 -14.1358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0521 -14.1358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0132 -13.4300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8263 -12.6128 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.4094 -14.1316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4607 -14.8456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0438 -15.5473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7998 -15.5349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4094 -13.1287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7998 -14.1358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3871 -14.8415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3788 -16.2530 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.4483 -16.2613 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.2349 -11.8905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2225 -16.4470 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
31.5073 -13.0214 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
27.5534 -16.2470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2737 -16.2675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2861 -14.8503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6927 -15.5663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5173 -15.5713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9349 -14.8612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5218 -14.1406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6985 -14.1391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3546 -14.9488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9984 -14.8415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0520 -11.8834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7577 -12.2864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7506 -11.4693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7521 -14.8658 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.1567 -15.5757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9739 -15.5803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6773 -15.9916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6818 -15.1744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 2 2 0
5 1 1 0
6 5 1 0
7 3 1 0
8 2 1 0
9 3 1 0
10 7 1 0
11 16 1 0
1 12 1 1
13 14 1 0
14 5 1 0
15 4 1 0
16 12 1 0
17 8 2 0
18 17 1 0
19 15 1 0
14 20 1 6
21 11 1 0
5 22 1 1
7 23 1 6
4 6 1 0
7 11 1 0
9 13 1 0
8 10 1 0
18 15 2 0
19 24 1 0
20 25 1 0
13 26 1 6
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
3 32 1 6
32 33 1 0
14 33 1 0
21 34 1 0
35 34 1 0
36 35 1 0
34 36 1 0
29 37 1 0
37 38 1 0
38 39 1 0
40 39 1 0
41 40 1 0
39 41 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 526.72Molecular Weight (Monoisotopic): 526.3195AlogP: 5.91#Rotatable Bonds: 8Polar Surface Area: 42.96Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 10.11CX LogP: 5.00CX LogD: 2.35Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.46Np Likeness Score: 0.87
References 1. Xiao L, Wang Y, Zhang M, Wu W, Kong L, Ma Y, Xu X, Liu X, He Q, Qian Y, Sun H, Wu H, Lin C, Huang H, Ye R, Jiang S, Ye RF, Yuan C, Fang S, Xue D, Yang X, Chen H, Zheng Y, Yu L, Xie Q, Zheng L, Fu W, Li W, Qiu Z, Liu J, Shao L.. (2019) Discovery of a Highly Selective and Potent κ Opioid Receptor Agonist from N -Cyclopropylmethyl-7α-phenyl-6,14-endoethanotetrahydronorthebaines with Reduced Central Nervous System (CNS) Side Effects Navigated by the Message-Address Concept., 62 (24): [PMID:31738550 ] [10.1021/acs.jmedchem.9b00857 ]