The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N1-(1-((4-chlorophenyl)amino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl)-N8-hydroxyoctanediamide ID: ALA4570814
PubChem CID: 155561174
Max Phase: Preclinical
Molecular Formula: C25H29ClN4O4
Molecular Weight: 484.98
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCCCCCC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)Nc1ccc(Cl)cc1)NO
Standard InChI: InChI=1S/C25H29ClN4O4/c26-18-11-13-19(14-12-18)28-25(33)22(15-17-16-27-21-8-6-5-7-20(17)21)29-23(31)9-3-1-2-4-10-24(32)30-34/h5-8,11-14,16,22,27,34H,1-4,9-10,15H2,(H,28,33)(H,29,31)(H,30,32)
Standard InChI Key: VVMDUDBIXQDAFV-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
15.9294 -1.4660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3671 -2.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6027 -2.8452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7231 -1.6512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9617 -2.4319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4013 -3.0349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8016 -3.7542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.6094 -3.5958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7083 -2.7786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4224 -2.3812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1235 -2.8010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8376 -2.4036 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.1106 -3.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3966 -4.0154 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.8118 -4.0378 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.3837 -4.8325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6689 -5.2240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6557 -6.0404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3574 -6.4609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0739 -6.0592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0836 -5.2441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5388 -2.8233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2529 -2.4259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5259 -3.6404 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.9540 -2.8456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6681 -2.4483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3693 -2.8680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0833 -2.4706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7845 -2.8903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4986 -2.4929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1997 -2.9126 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.5115 -1.6758 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.9138 -2.5153 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.3456 -7.2780 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
9 10 1 0
10 11 1 0
11 12 1 0
11 13 1 0
13 14 1 0
13 15 2 0
14 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
12 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
30 32 2 0
31 33 1 0
19 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 484.98Molecular Weight (Monoisotopic): 484.1877AlogP: 4.33#Rotatable Bonds: 12Polar Surface Area: 123.32Molecular Species: NEUTRALHBA: 4HBD: 5#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.91CX Basic pKa: ┄CX LogP: 3.83CX LogD: 3.81Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.15Np Likeness Score: -0.56
References 1. Zhang Q, Lv J, He F, Yu C, Qu Y, Zhang X, Xu A, Wu J.. (2019) Design, synthesis and activity evaluation of indole-based double - Branched HDAC1 inhibitors., 27 (8): [PMID:30879863 ] [10.1016/j.bmc.2019.03.008 ]