The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-((S)-1-cyclohexyl-2-((R)-2-methyloxiran-2-yl)-2-oxoethyl)-3-(4-methoxyphenyl)-2-((S)-2-(2-morpholinoacetamido)propanamido)propanamide ID: ALA4570830
PubChem CID: 155561390
Max Phase: Preclinical
Molecular Formula: C30H44N4O7
Molecular Weight: 572.70
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C[C@H](NC(=O)[C@H](C)NC(=O)CN2CCOCC2)C(=O)N[C@H](C(=O)[C@@]2(C)CO2)C2CCCCC2)cc1
Standard InChI: InChI=1S/C30H44N4O7/c1-20(31-25(35)18-34-13-15-40-16-14-34)28(37)32-24(17-21-9-11-23(39-3)12-10-21)29(38)33-26(22-7-5-4-6-8-22)27(36)30(2)19-41-30/h9-12,20,22,24,26H,4-8,13-19H2,1-3H3,(H,31,35)(H,32,37)(H,33,38)/t20-,24-,26-,30+/m0/s1
Standard InChI Key: HPDUMJMJUGLHJL-TVYSDHEISA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
25.1513 -3.1656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5641 -3.8755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9725 -3.1631 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.7801 -4.2882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4878 -3.8796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1955 -4.2882 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.4878 -3.0624 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.9032 -3.8796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6109 -4.2882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9032 -3.0624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6109 -5.1054 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.3186 -3.8796 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.0264 -4.2882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7341 -3.8796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0264 -5.1054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4418 -4.2882 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.7341 -3.0624 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.1495 -3.8796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8572 -4.2882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8572 -5.1054 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.2726 -4.2882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0724 -3.8796 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.0767 -3.0615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3731 -2.6530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6630 -3.0581 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6610 -3.8762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3692 -4.2892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7341 -5.5140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7300 -6.3322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4369 -6.7408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1456 -6.3321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1430 -5.5107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4355 -5.1059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8538 -6.7398 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.8549 -7.5569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1495 -3.0624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8596 -2.6560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8615 -1.8424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1556 -1.4300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4461 -1.8374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4425 -2.6572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 0
1 3 1 0
4 5 1 0
5 6 1 0
5 7 2 0
6 8 1 0
8 9 1 0
8 10 1 1
9 11 2 0
9 12 1 0
12 13 1 0
13 14 1 0
13 15 1 6
14 16 1 0
14 17 2 0
16 18 1 0
18 19 1 0
19 2 1 0
19 20 2 0
2 21 1 6
4 22 1 0
22 23 1 0
22 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
15 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
31 34 1 0
34 35 1 0
18 36 1 1
36 37 1 0
36 41 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 572.70Molecular Weight (Monoisotopic): 572.3210AlogP: 0.98#Rotatable Bonds: 13Polar Surface Area: 138.60Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.86CX Basic pKa: 5.04CX LogP: 1.72CX LogD: 1.72Aromatic Rings: 1Heavy Atoms: 41QED Weighted: 0.30Np Likeness Score: -0.47
References 1. Xin BT, Huber EM, de Bruin G, Heinemeyer W, Maurits E, Espinal C, Du Y, Janssens M, Weyburne ES, Kisselev AF, Florea BI, Driessen C, van der Marel GA, Groll M, Overkleeft HS.. (2019) Structure-Based Design of Inhibitors Selective for Human Proteasome β2c or β2i Subunits., 62 (3): [PMID:30657666 ] [10.1021/acs.jmedchem.8b01884 ]